| Company Name: |
Mainchem Co., Ltd.
|
| Tel: |
+86-0592-6210733 |
| Email: |
sale@mainchem.com |
| Products Intro: |
Product Name:1,2,3,4,5,6,7,8-OCTAHYDROPHENANTHRENE
CAS:5325-97-3
|
| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
010-82848833 400-666-7788 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:1,2,3,4,5,6,7,8-Octahydrophenanthrene
CAS:5325-97-3
Purity:95.0%(GC) Package:1G,5G
|
1,2,3,4,5,6,7,8-OCTAHYDROPHENANTHRENE manufacturers
|
| | 1,2,3,4,5,6,7,8-OCTAHYDROPHENANTHRENE Basic information |
| Product Name: | 1,2,3,4,5,6,7,8-OCTAHYDROPHENANTHRENE | | Synonyms: | Phenanthrene, 1,2,3,4,5,6,7,8-octahydro-;1,2,3,4,5,6,7,8-OCTAHYDROPHENANTHRENE;1,2,3,4,5,6,7,8-0ctahydrophenanthrene;Octahydrophenanthrene;1,2,3,4,5,6,7,8-OCTAHYDROPHENANTHRENE 95+% GC;Inchi=1/C14H18/C1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)13/H9-10H,1-8h;1,2,3,4,5,6,7,8-Octahydrophenanthrene>;1,2,3,4,5,6,7,8-Octahydrophenanthrene, ≥ 95.0% | | CAS: | 5325-97-3 | | MF: | C14H18 | | MW: | 186.29 | | EINECS: | 226-199-6 | | Product Categories: | | | Mol File: | 5325-97-3.mol |  |
| | 1,2,3,4,5,6,7,8-OCTAHYDROPHENANTHRENE Chemical Properties |
| Melting point | 16.7°C | | Boiling point | 295 °C | | density | 1.03 | | refractive index | 1.5650 to 1.5680 | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | powder to lump to clear liquid | | color | White or Colorless to Almost white or Almost colorless | | CAS DataBase Reference | 5325-97-3(CAS DataBase Reference) |
| | 1,2,3,4,5,6,7,8-OCTAHYDROPHENANTHRENE Usage And Synthesis |
| Uses | 1,2,3,4,5,6,7,8-Octahydrophenanthrene is a polyaromatic hydrocarbon (PAH), an environmental pollutant. |
| | 1,2,3,4,5,6,7,8-OCTAHYDROPHENANTHRENE Preparation Products And Raw materials |
| Raw materials | 1,2,3,4,5,6,7,8-OCTAHYDROANTHRACENE-->Phenanthrene | | Preparation Products | PHENANTHRENE,1,2,3,4-TETRA--->1,2,3,4,4a,9,10,10a-octahydrophenanthrene-->9,10-DIHYDROPHENANTHRENE |
|