|
|
| | 1H,1H,7H-Dodecafluoroheptyl methacrylate Basic information |
| Product Name: | 1H,1H,7H-Dodecafluoroheptyl methacrylate | | Synonyms: | DAIKIN M-5610;1H,1H,7H-DODECAFLUOROHEPTYL METHACRYLATE;1H,1H,7H-PERFLUOROHEPTYL METHACRYLATE;2,2,3,3,4,4,5,5,6,6,7,7-Dodecafluoroheptyl methacrylate;TRIHYDROPERFLUOROHEPTYL METHACRYLATE;2-methyl-acrylicacid1H,1H,7H-dodecafluoro-heptylester;2-methyl-acrylicacid2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoro-heptylester;1H,1H,7H-Perfluoroheptyl methacrylate 97% | | CAS: | 2261-99-6 | | MF: | C11H8F12O2 | | MW: | 400.16 | | EINECS: | 218-863-9 | | Product Categories: | monomer | | Mol File: | 2261-99-6.mol |  |
| | 1H,1H,7H-Dodecafluoroheptyl methacrylate Chemical Properties |
| Boiling point | 112 °C | | density | 1.536 | | refractive index | 1.349 | | Fp | 104 | | storage temp. | Keep Cold | | form | clear liquid | | Specific Gravity | 1.536 | | color | Colorless to Light yellow to Light orange | | InChI | InChI=1S/C11H8F12O2/c1-4(2)5(24)25-3-7(14,15)9(18,19)11(22,23)10(20,21)8(16,17)6(12)13/h6H,1,3H2,2H3 | | InChIKey | YJKHMSPWWGBKTN-UHFFFAOYSA-N | | SMILES | C(OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F)(=O)C(C)=C | | CAS DataBase Reference | 2261-99-6(CAS DataBase Reference) | | EPA Substance Registry System | (6H-Perfluorohexyl)methyl methacrylate (2261-99-6) |
| | 1H,1H,7H-Dodecafluoroheptyl methacrylate Usage And Synthesis |
| Definition |
1H,1H,7H-Dodecafluoroheptyl methacrylate is a fluorinated acrylate monomer. It is very hydrophobic, has log energy surface and exhibits chemical resistant properties.
|
| | 1H,1H,7H-Dodecafluoroheptyl methacrylate Preparation Products And Raw materials |
|