| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Thallium (I) trifluoromethanesulfonate Basic information |
| Product Name: | Thallium (I) trifluoromethanesulfonate | | Synonyms: | THALLIUM TRIFLATE;thallium(i)trifluoromethanesulfonate(thalliumtriflate);Trifluoromethanesulfonic acid thallous salt;ThalliuM(I) trifluoroMethanesulfonate 97%;Thallium(I) trifluoromethylsulfonate;Tl(OTf);Thallium(I)trifluoromethanesulfonate,99%(Thalliumtriflate);Trifluoromethanesulfonic acid th | | CAS: | 73491-36-8 | | MF: | CF3O3STl | | MW: | 353.45 | | EINECS: | | | Product Categories: | metal triflate compounds | | Mol File: | 73491-36-8.mol |  |
| | Thallium (I) trifluoromethanesulfonate Chemical Properties |
| Melting point | 245-250°C | | storage temp. | 2-8°C | | solubility | soluble in Methanol, Water | | form | Powder | | color | white | | Stability: | hygroscopic | | InChI | 1S/CHF3O3S.Tl/c2-1(3,4)8(5,6)7;/h(H,5,6,7);/q;+1/p-1 | | InChIKey | PDFSYPYWCONFDC-UHFFFAOYSA-M | | SMILES | [Tl+].[O-]S(=O)(=O)C(F)(F)F | | CAS DataBase Reference | 73491-36-8 |
| Hazard Codes | T+,N | | Risk Statements | 26/28-33-51/53-36/37/38-28-26 | | Safety Statements | 13-28-45-61-26 | | RIDADR | 1707 | | WGK Germany | 3 | | Storage Class | 6.1B - Non-combustible acute toxic Cat. 1 and 2 very toxic hazardous materials | | Hazard Classifications | Acute Tox. 2 Inhalation Acute Tox. 2 Oral Aquatic Chronic 2 STOT RE 2 |
| | Thallium (I) trifluoromethanesulfonate Usage And Synthesis |
| Uses | Thallium(I) trifluoromethanesulfonate is an used as a reagent in inorganic synthesis such as transition metal catalysts for intramolecular hydroamination of alkynes. | | reaction suitability | core: thallium reagent type: catalyst |
| | Thallium (I) trifluoromethanesulfonate Preparation Products And Raw materials |
|