4-Methoxybenzoic acid 4-(6-acryloyloxy-hexyloxy)phenyl ester manufacturers
|
| | 4-Methoxybenzoic acid 4-(6-acryloyloxy-hexyloxy)phenyl ester Basic information |
| Product Name: | 4-Methoxybenzoic acid 4-(6-acryloyloxy-hexyloxy)phenyl ester | | Synonyms: | Benzoic acid,4-Methoxy-,4-[[6-[(1-oxo-2-propen-1-yl)oxy]hexyl]oxy]phenyl ester;4-methoxybenzoic acid 4-(6-acryloyloxyhexyloxy)phenyl;4-(6-prop-2-enoyloxyhexoxy)phenyl]4-methoxybenzoate;4-[[6-[(1-Oxo-2-propen-1-yl)oxy]hexyl]oxy]phenyl 4-methoxybenzoate;4-[[6-[(1-Oxo-allyloxy)]hexyl]oxy]phenyl 4-methoxy-benzoate;4-Methoxybenzoic acid 4-(6-acryloyloxy-hexyloxy)phenyl ester | | CAS: | 130953-14-9 | | MF: | C23H26O6 | | MW: | 398.45 | | EINECS: | | | Product Categories: | | | Mol File: | 130953-14-9.mol |  |
| | 4-Methoxybenzoic acid 4-(6-acryloyloxy-hexyloxy)phenyl ester Chemical Properties |
| Boiling point | 539.9±45.0 °C(Predicted) | | density | 1.133±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, stored under nitrogen | | Appearance | White to off-white Solid | | InChI | InChI=1S/C23H26O6/c1-3-22(24)28-17-7-5-4-6-16-27-20-12-14-21(15-13-20)29-23(25)18-8-10-19(26-2)11-9-18/h3,8-15H,1,4-7,16-17H2,2H3 | | InChIKey | DGTILUBISWZGND-UHFFFAOYSA-N | | SMILES | C(OC1=CC=C(OCCCCCCOC(=O)C=C)C=C1)(=O)C1=CC=C(OC)C=C1 |
| | 4-Methoxybenzoic acid 4-(6-acryloyloxy-hexyloxy)phenyl ester Usage And Synthesis |
| | 4-Methoxybenzoic acid 4-(6-acryloyloxy-hexyloxy)phenyl ester Preparation Products And Raw materials |
|