4-Vinylbenzyl glycidyl ether manufacturers
|
| | 4-Vinylbenzyl glycidyl ether Basic information |
| Product Name: | 4-Vinylbenzyl glycidyl ether | | Synonyms: | 4-Vinylbenzyl glycidyl ether;2-{[(4-ethenylphenyl)Methoxy]Methyl}oxirane;4-vinylbenzylglycidy ether crude;4-vinylbenzylglycidy ether;p-Vinylbenzyl glycidyl ether;Glycidyl p-vinylbenzyl ether;Glycidyl 4-vinylbenzyl ether;Oxirane, 2-[[(4-ethenylphenyl)methoxy]methyl]- | | CAS: | 113538-80-0 | | MF: | C12H14O2 | | MW: | 190.24 | | EINECS: | | | Product Categories: | Chloromethy styrene | | Mol File: | 113538-80-0.mol |  |
| | 4-Vinylbenzyl glycidyl ether Chemical Properties |
| Boiling point | 299.2±20.0 °C(Predicted) | | density | 1.087±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C12H14O2/c1-2-10-3-5-11(6-4-10)7-13-8-12-9-14-12/h2-6,12H,1,7-9H2 | | InChIKey | ZADXFVHUPXKZBJ-UHFFFAOYSA-N | | SMILES | O1CC1COCC1=CC=C(C=C)C=C1 |
| | 4-Vinylbenzyl glycidyl ether Usage And Synthesis |
| Uses | 4-Vinylbenzyl Glycidyl Ether is a useful research chemical compound used as a reactant in amide synthesis from alcohols and amines. |
| | 4-Vinylbenzyl glycidyl ether Preparation Products And Raw materials |
|