|
|
| | QUERCETIN DIHYDRATE(RG) Basic information |
| Product Name: | QUERCETIN DIHYDRATE(RG) | | Synonyms: | QUERCETIN DIHYDRATE(RG);QUERCETIN-3,4'-DI-O-GLUCOSIDE(SH);4H-1-Benzopyran-4-one, 3-(β-D-glucopyranosyloxy)-2-[4-(β-D-glucopyranosyloxy)-3-hydroxyphenyl]-5,7-dihydroxy-;4-[3-(β-D-Glucopyranosyloxy)-5,7-dihydroxy-4-oxo-4H-chromen-2-yl] -2-hydroxyphenyl β-D-glucopyranoside;Quercetin 3,4'-O-β-diglucoside;Quercetin-3,4'-di-O-glucoside;Quercetin 3,4'-diglucoside | | CAS: | 29125-80-2 | | MF: | C27H30O17 | | MW: | 626.52 | | EINECS: | | | Product Categories: | | | Mol File: | 29125-80-2.mol |  |
| | QUERCETIN DIHYDRATE(RG) Chemical Properties |
| Melting point | 185-189℃ | | Boiling point | 1029.3±65.0 °C(Predicted) | | density | 1.89±0.1 g/cm3 (20 ºC 760 Torr) | | storage temp. | -20°C | | solubility | DMSO (Slightly), Pyridine (Slightly, Sonicated), Water (Very Slightly) | | form | Solid | | pka | 6.17±0.40(Predicted) | | color | Light Yellow | | Major Application | metabolomics vitamins, nutraceuticals, and natural products | | InChIKey | RPVIQWDFJPYNJM-DEFKTLOSSA-N | | SMILES | OC1=CC(O)=C2C(OC(C3=CC(O)=C(O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)C=C3)=C(O[C@H]5[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O5)C2=O)=C1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | QUERCETIN DIHYDRATE(RG) Usage And Synthesis |
| Uses | Quercetin 3,4''-Diglucoside is a flavonoid that has shown to be the antioxidative phenolic constituent of skins of onions. | | Definition | ChEBI: Quercetin 3,4'-di-O-beta-D-glucoside is a quercetin O-glucoside that is quercetin with two beta-D-glucosyl residues attached at positions 3 and 4'. It has a role as a plant metabolite, a radical scavenger and a cardioprotective agent. It is a beta-D-glucoside, a monosaccharide derivative, a polyphenol, a quercetin O-glucoside and a trihydroxyflavone. | | Biological Activity | Natural compound isolated from onions. Belongs to the class of organic compounds known as flavanoid-3-o-glycosides. Quercetin possesses free radical scavenging activity, due to the presence of phenolic hydroxyl groups present at the B-ring and position 3. The glycosidic form of quercetin is metabolized to its conjugates (glucuronide or sulfate) for absorption in the intestine.', 'Natural compound isolated from onions. Belongs to the class of organic compounds known as flavanoid-3-o-glycosides. |
| | QUERCETIN DIHYDRATE(RG) Preparation Products And Raw materials |
|