|
|
| | 1-Bromo-2-chloro-5-fluoro-4-nitrobenzene Basic information |
| Product Name: | 1-Bromo-2-chloro-5-fluoro-4-nitrobenzene | | Synonyms: | 1-Bromo-2-chloro-5-fluoro-4-nitrobenzene;4-Bromo-5-chloro-2-fluoronitrobenzene;Benzene, 1-bromo-2-chloro-5-fluoro-4-nitro-;4-Bromo-5-chloro-2-fluoronitrobenzene 98%;1-Bromo-2-chloro-5-fluoro-4-nitrobenze;2-fluorine-4-bromo-5-chloronitrobenzene | | CAS: | 1027833-17-5 | | MF: | C6H2BrClFNO2 | | MW: | 254.44 | | EINECS: | | | Product Categories: | | | Mol File: | 1027833-17-5.mol |  |
| | 1-Bromo-2-chloro-5-fluoro-4-nitrobenzene Chemical Properties |
| Boiling point | 291.0±35.0 °C(Predicted) | | density | 1.904±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | form | solid | | color | Off-white | | InChI | InChI=1S/C6H2BrClFNO2/c7-3-1-5(9)6(10(11)12)2-4(3)8/h1-2H | | InChIKey | DIPJMSNYGIUYII-UHFFFAOYSA-N | | SMILES | C1(Br)=CC(F)=C([N+]([O-])=O)C=C1Cl |
| | 1-Bromo-2-chloro-5-fluoro-4-nitrobenzene Usage And Synthesis |
| | 1-Bromo-2-chloro-5-fluoro-4-nitrobenzene Preparation Products And Raw materials |
|