| Company Name: |
INTATRADE GmbH |
| Tel: |
+49 3493/605464 |
| Email: |
sales@intatrade.de |
|
| | 1-Chlorocarbonyl-4-piperidinopiperidine hydrochloride Basic information |
| Product Name: | 1-Chlorocarbonyl-4-piperidinopiperidine hydrochloride | | Synonyms: | 1-(Chlorocarbonyl)-4-(piperidin-1-yl)piperidine hydrochloride;1,4'-Bipiperidine-1'-carbonyl chloride hydrochloride;1-Chlorocarbonyl-4-piperidinopiperidine HCL;1-CHLOROCARBONYL-4-PIPERIDINOPIPERIDINE HYDROCHLORIDE;1-(Chlorocarbonyl)-4-(piperidin-1-yl)piperidine hydrochloride 85%;1,4'-bipiperidine-1'-carbonyl
chloride;4'-bipiperidine-1'-carbonyl chloride;[1,4'-Bipiperidine]-1'-carbonyl chloride HCl | | CAS: | 143254-82-4 | | MF: | C11H20Cl2N2O | | MW: | 267.19 | | EINECS: | 686-744-2 | | Product Categories: | Piperidine | | Mol File: | 143254-82-4.mol |  |
| | 1-Chlorocarbonyl-4-piperidinopiperidine hydrochloride Chemical Properties |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | Appearance | White to off-white Solid | | InChI | InChI=1S/C11H19ClN2O.ClH/c12-11(15)14-8-4-10(5-9-14)13-6-2-1-3-7-13;/h10H,1-9H2;1H | | InChIKey | VBXXNCHZAMNCBX-UHFFFAOYSA-N | | SMILES | C(N1CCC(N2CCCCC2)CC1)(=O)Cl.Cl | | CAS DataBase Reference | 143254-82-4(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/38 | | Safety Statements | 26-28 | | HS Code | 2933399990 |
| | 1-Chlorocarbonyl-4-piperidinopiperidine hydrochloride Usage And Synthesis |
| Uses | 1-Chlorocarbonyl-4-piperidinopiperidine hydrochloride serves as a reagent for chrysin in refluxing acetonitrile with potassium carbonate, giving the chrysin-carbamate prodrug C-1[1]. | | References | [1]Zhang, R., Gao, C., Hu, M., Wang, X., Li, S., An, Z., Yang, X., & Xie, Y. (2024). Synthesis and biological evaluation of the novel chrysin prodrug for non-alcoholic fatty liver disease treatment. Frontiers in Pharmacology, 15. https://doi.org/10.3389/fphar.2024.1336232 |
| | 1-Chlorocarbonyl-4-piperidinopiperidine hydrochloride Preparation Products And Raw materials |
|