| Company Name: |
SunaTech Inc. |
| Tel: |
0512-62872180 18994314770 |
| Email: |
sales@sunatech.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| Product Name: | FBR | | Synonyms: | FBR;NFA003;5,5’-[(9,9-Dioctyl-9H-fluorene-2,7-diyl)bis(2,1,3-benzothiadiazole-7,4-diylmethylidyne)]bis[3-ethyl-2-thioxo-4-thiazolidinone] (FBR);5,5'-[(9,9-Dioctyl-9H-fluorene-2,7-diyl)bis(2,1,3-benzothiadiazole-7,4-diylmethylidyne)]bis[3-ethyl-2-thioxo-4-thiazolidinone];4-Thiazolidinone, 5,5'-[(9,9-dioctyl-9H-fluorene-2,7-diyl)bis(2,1,3-benzothiadiazole-7,4-diylmethylidyne)]bis[3-ethyl-2-thioxo-;5,5'-[(9,9-dioctyl-9H-fluorene-2,7-diyl)bis(2,1,3-benzothiadiazole-7,4-diylmethylidyne)]bis[3-ethyl-2-thioxo-4-Thiazolidinone N;(5Z,5'Z)-5,5'-((7,7'-(9,9-dioctyl-9H-fluorene-2,7-diyl)bis(benzo[c][1,2,5]thiadiazole-7,4-diyl))bis(methanylylidene))bis(3-ethyl-2-thioxothiazolidin-4-one);5,5'-(((9,9-Dioctyl-9H-fluorene-2,7-diyl)bis(benzo[c][1,2,5]thiadiazole-7,4-diyl))bis(methaneylylidene))bis(3-ethyl-2-thioxothiazolidin-4-one) | | CAS: | 1644381-95-2 | | MF: | C53H56N6O2S6 | | MW: | 1001.45 | | EINECS: | | | Product Categories: | | | Mol File: | 1644381-95-2.mol |  |
| Melting point | 190-201 °C | | density | 1.38±0.1 g/cm3(Predicted) | | pka | -2.32±0.50(Predicted) | | InChIKey | OLBOENQKGKQCJD-XOTMQJHLSA-N | | SMILES | S1\C(=C/c2c3n[s]nc3c(cc2)c4cc5c(cc4)c6c(cc(cc6)c7c8n[s]nc8c(cc7)\C=C9/SC(=S)N(C/9=O)CC)C5(CCCCCCCC)CCCCCCCC)\C(=O)N(C1=S)CC | | solubility | Chloroform, chlorobenzene | | Absorption | λmax 510 nm (Film) | | form | Red powder/crystals |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| Description | FBR, having a similar AA-D-AA type structure to IDFBR, contains electron-donating alkylated fluorene as the core, flanked by electron withdrawing benzothiadiazole (BT) and 3-ethylrhodanine units on the periphery terminals. |
| | FBR Preparation Products And Raw materials |
|