Ubrogepant Intermediate manufacturers
|
| | Ubrogepant Intermediate Basic information |
| Product Name: | Ubrogepant Intermediate | | Synonyms: | Ubrogepant Intermediate;(3'S)-1',2',5,7-Tetrahydro-2'-oxospiro[6H-cyclopenta[b]pyridine-6,3'-[3H]pyrrolo[2,3-b]pyridine]-3-carboxylic acid;(3S)-2-oxospiro[1H-pyrrolo[2,3-b]pyridine-3,6'-5,7-dihydrocyclopenta[b]pyridine]-3'-carboxylic acid;Spiro[6H-cyclopenta[b]pyridine-6,3'-[3H]pyrrolo[2,3-b]pyridine]-3-carboxylic acid, 1',2',5,7-tetrahydro-2'-oxo-, (3'S)-;(S)-2'-oxo-1',2',5,7-tetrahydrospiro[cyclopenta[b]pyridine-6...;Ubrogepant?intermediate B00;Atogepant Impurity 3;Ubrogepant Impurity 2 | | CAS: | 1375541-21-1 | | MF: | C15H11N3O3 | | MW: | 281.27 | | EINECS: | | | Product Categories: | | | Mol File: | 1375541-21-1.mol |  |
| | Ubrogepant Intermediate Chemical Properties |
| Boiling point | 566.1±50.0 °C(Predicted) | | density | 1.57±0.1 g/cm3(Predicted) | | pka | 2.36±0.20(Predicted) | | InChI | InChI=1S/C15H11N3O3/c19-13(20)9-4-8-5-15(6-11(8)17-7-9)10-2-1-3-16-12(10)18-14(15)21/h1-4,7H,5-6H2,(H,19,20)(H,16,18,21)/t15-/m0/s1 | | InChIKey | JZRARRAPRCNVSS-HNNXBMFYSA-N | | SMILES | C12C[C@@]3(C(=O)NC4=NC=CC=C43)CC1=CC(C(O)=O)=CN=2 |
| | Ubrogepant Intermediate Usage And Synthesis |
| Uses | This is ubrogepant's intermediate, used as chemical references/standards. |
| | Ubrogepant Intermediate Preparation Products And Raw materials |
|