| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
4-Methyl-3-nitrobenzenesulfonamide manufacturers
|
| | 4-Methyl-3-nitrobenzenesulfonamide Basic information |
| | 4-Methyl-3-nitrobenzenesulfonamide Chemical Properties |
| Melting point | 144°C | | Boiling point | 399.7±52.0 °C(Predicted) | | density | 1.475 | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | solid | | pka | 9.59±0.60(Predicted) | | Appearance | White to light yellow Solid | | InChI | 1S/C7H8N2O4S/c1-5-2-3-6(14(8,12)13)4-7(5)9(10)11/h2-4H,1H3,(H2,8,12,13) | | InChIKey | HVCWTENLJRUJPU-UHFFFAOYSA-N | | SMILES | Cc1ccc(cc1[N+]([O-])=O)S(N)(=O)=O | | CAS DataBase Reference | 6949-23-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2935909099 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 4-Methyl-3-nitrobenzenesulfonamide Usage And Synthesis |
| Uses | 4-Methyl-3-nitrobenzenesulfonamide is an intermediate used to prepare α-keto amide inhibitors of hepatitis C virus NS3 protease. It is also used to synthesize 1,4-diazepane-3,5-dione derivs. for prevention and treatment of various diseases associated with chymase. |
| | 4-Methyl-3-nitrobenzenesulfonamide Preparation Products And Raw materials |
|