|
|
| | Ethyl 2,3,4-tri-O-benzyl-1-thio-beta-L-fucopyranoside Basic information |
| Product Name: | Ethyl 2,3,4-tri-O-benzyl-1-thio-beta-L-fucopyranoside | | Synonyms: | Ethyl 2,3,4-tri-O-benzyl-b-L-thiofucopyranoside;b-L-Galactopyranoside, ethyl 6-deoxy-2,3,4-tris-O-(phenylMethyl)-1-thio-;1-S-2,3,4-Tri-O-benzyl-1-thiofucopyranoside;2,3,4-TRI-O-BENZYL-1-S-ETHYL-BETA-L-THIOFUCOPYRANOSIDE;Ethyl-2,3,4-tri-benzyl-β-L-thiofucopyranoside;(2R,3S,4R,5R,6S)-3,4,5-Tris(benzyloxy)-2-(ethylthio)-6-methyltetrahydro-2H-pyran;(2R,3S,4R,5R,6S)-2-ethylsulfanyl-6-methyl-3,4,5-tris(phenylmethoxy)oxane;Ethyl 2,3,4-tri-O-benzyl-1-thio-β-L-fucopyranoside | | CAS: | 99409-34-4 | | MF: | C29H34O4S | | MW: | 478.65 | | EINECS: | 604-604-1 | | Product Categories: | | | Mol File: | 99409-34-4.mol |  |
| | Ethyl 2,3,4-tri-O-benzyl-1-thio-beta-L-fucopyranoside Chemical Properties |
| Melting point | 52-54 °C(lit.) | | Boiling point | 592.1±50.0 °C(Predicted) | | density | 1.16±0.1 g/cm3(Predicted) | | Fp | >230 °F | | Optical Rotation | [α]22/D 15°, c = 1.5 in methylene chloride | | InChIKey | RZVKVTBAQRMTEH-IIBMJOFSNA-N | | SMILES | [C@@H]1(OCC2C=CC=CC=2)[C@H](OCC2C=CC=CC=2)[C@@H](O[C@H](SCC)[C@H]1OCC1C=CC=CC=1)C |&1:0,9,18,20,24,r| |
| | Ethyl 2,3,4-tri-O-benzyl-1-thio-beta-L-fucopyranoside Usage And Synthesis |
| | Ethyl 2,3,4-tri-O-benzyl-1-thio-beta-L-fucopyranoside Preparation Products And Raw materials |
|