|
|
| | Ethyl 2-amino-4-methyl-5-(4-nitrophenyl)thiophene-3-carboxylate Basic information |
| Product Name: | Ethyl 2-amino-4-methyl-5-(4-nitrophenyl)thiophene-3-carboxylate | | Synonyms: | ETHYL 2-AMINO-4-METHYL-5-(4-NITRO-PHENYL)-THIOPHENE-3-CARBOXYLATE;2-Amino-4-methyl-5-(4-nitro-phenyl)-thiophene-3-carboxylic acid ethyl ester;2-Amino-4-methyl-5-(4-nitrophenyl)-3-thiophenecarboxylic acid ethyl ester;Ethyl 2-amino-4-methyl-5-(4-nitro-phenyl)-thiophene-3-carboxylat;RELU-001;2-Amino-4-methyl-5-(4-nitrophenyl)-3-thiophenecarboxylic a;3-Thiophenecarboxylic acid, 2-amino-4-methyl-5-(4-nitrophenyl)-, ethyl ester;2-amino-4-methyl-5-(4-nitrophenyl)-thiophen-3-carboxylic acid ethyl ester | | CAS: | 174072-89-0 | | MF: | C14H14N2O4S | | MW: | 306.34 | | EINECS: | 839-928-3 | | Product Categories: | | | Mol File: | 174072-89-0.mol |  |
| | Ethyl 2-amino-4-methyl-5-(4-nitrophenyl)thiophene-3-carboxylate Chemical Properties |
| Boiling point | 464.6±45.0 °C(Predicted) | | density | 1.337 | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | pka | -0.68±0.10(Predicted) | | InChI | InChI=1S/C14H14N2O4S/c1-3-20-14(17)11-8(2)12(21-13(11)15)9-4-6-10(7-5-9)16(18)19/h4-7H,3,15H2,1-2H3 | | InChIKey | CXRJNUVDWUINBY-UHFFFAOYSA-N | | SMILES | C1(N)SC(C2=CC=C([N+]([O-])=O)C=C2)=C(C)C=1C(OCC)=O |
| | Ethyl 2-amino-4-methyl-5-(4-nitrophenyl)thiophene-3-carboxylate Usage And Synthesis |
| Uses | Ethyl 2-amino-4-methyl-5-(4-nitrophenyl)thiophene-3-carboxylate is an intermediate compound used in the synthesis of Relugolix, which belongs to a class of gonadotropin-releasing hormone (GnRH) receptor antagonists used to treat advanced prostate cancer in adult men. Relugolix belongs to a group of Gonadotropin-releasing hormone (GnRH) receptor antagonists that are used to treat advanced prostate cancer in adult men. |
| | Ethyl 2-amino-4-methyl-5-(4-nitrophenyl)thiophene-3-carboxylate Preparation Products And Raw materials |
|