| Company Name: |
Mascot I.E. Co., Ltd
|
| Tel: |
0519-85010339 13584504415 |
| Email: |
info@mascot-ie.com |
| Products Intro: |
Product Name:2,7-diphenyl-9H-Fluoren-9-one
CAS:115033-91-5
Purity:99.00% Package:118kg/drum
|
| Company Name: |
Suzhou Rovathin Foreign Trade Co.,Ltd
|
| Tel: |
0512-65816829 18662214788 |
| Email: |
info@rovathin.com.cn |
| Products Intro: |
Product Name:2,7-diphenyl-9H-Fluoren-9-one
CAS:115033-91-5
Package:100g/;1000g/
|
|
| | 2,7-diphenyl-9H-Fluoren-9-one Basic information |
| | 2,7-diphenyl-9H-Fluoren-9-one Chemical Properties |
| Melting point | 235.3 °C(Solv: dichloromethane (75-09-2); ligroine (8032-32-4)) | | Boiling point | 581.2±30.0 °C(Predicted) | | density | 1.206±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C25H16O/c26-25-23-15-19(17-7-3-1-4-8-17)11-13-21(23)22-14-12-20(16-24(22)25)18-9-5-2-6-10-18/h1-16H | | InChIKey | JHPVZYUJSQWUBP-UHFFFAOYSA-N | | SMILES | C1(=O)C2=C(C=CC(C3=CC=CC=C3)=C2)C2=C1C=C(C1=CC=CC=C1)C=C2 |
| | 2,7-diphenyl-9H-Fluoren-9-one Usage And Synthesis |
| | 2,7-diphenyl-9H-Fluoren-9-one Preparation Products And Raw materials |
|