Edoxaban Impurity 29 manufacturers
- Edoxaban Impurity
-
- $0.00 / 10mg
-
2025-06-18
- CAS:2244103-96-4
- Min. Order: 10mg
- Purity: 95%+
- Supply Ability: 1000000000
|
| | Edoxaban Impurity 29 Basic information |
| Product Name: | Edoxaban Impurity 29 | | Synonyms: | (5S)-5-Oxide Edoxaban;(R)-2-(((1R,2S,5S)-2-(2-((5-chloropyridin-2-yl)amino)-2-oxoacetamido)-5-(dimethylcarbamoyl)cyclohexyl)carbamoyl)-5-methyl-4,5,6,7-tetrahydrothiazolo[5;2-(((1R,2S,5S)-2-(2-((5-Chloropyridin-2-yl)amino)-2-oxoacetamido)-5-(dimethylcarbamoyl)cyclohexyl)carbamoyl)-5-methyl-4,5,6,7-tetrahydrothiazolo[5,4-c]pyridine 5-oxide（Edoxaban Impurity）;Ethanediamide, N1-(5-chloro-2-pyridinyl)-N2-[(1S,2R,4S)-4-[(dimethylamino)carbonyl]-2-[[(4,5,6,7-tetrahydro-5-methyl-5-oxidothiazolo[5,4-c]pyridin-2-yl)carbonyl]amino]cyclohexyl]-;Yidu Saban Impurity N;N-Oxide Edoxabane;EthanediaMide iMpurity N;Etilefrine Impurity 13 | | CAS: | 2244103-96-4 | | MF: | C24H30ClN7O5S | | MW: | 564.06 | | EINECS: | | | Product Categories: | | | Mol File: | 2244103-96-4.mol |  |
| | Edoxaban Impurity 29 Chemical Properties |
| Melting point | >90°C (dec.) | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly, Heated, Sonicated) | | form | Solid | | pka | 9.46±0.70(Predicted) | | color | Pale Yellow to Yellow | | Stability: | Hygroscopic | | InChIKey | VXYMWDLQMMPOMS-QDYCCJOXSA-N | | SMILES | C(NC1=NC=C(Cl)C=C1)(=O)C(N[C@H]1CC[C@H](C(N(C)C)=O)C[C@H]1NC(C1=NC2CC[N+]([O-])(C)CC=2S1)=O)=O |
| | Edoxaban Impurity 29 Usage And Synthesis |
| Uses | (5S)-5-Oxide Edoxaban is an impurity of Edoxaban (E555520). Edoxaban is an anticoagulant drug which acts as a direct factor Xa inhibitor. |
| | Edoxaban Impurity 29 Preparation Products And Raw materials |
|