|
|
| | 2-Amino-indan-2-carboxylic acid methyl ester hydrochloride Basic information |
| Product Name: | 2-Amino-indan-2-carboxylic acid methyl ester hydrochloride | | Synonyms: | 2-AMINO-INDANE-2-CARBOXYLIC ACID METHYL ESTER HCL;2-Aminoindan-2-carboxylic acid methyl ester HCl;1H-Indene-2-carboxylic acid, 2-aMino-2,3-dihydro-, Methyl ester, hydrochloride;H-Aic-OMe.HCl;1H-Indene-2-carboxylic acid, 2-amino-2,3-dihydro-, methyl ester, hydrochloride (1:1);Methyl 2-Amino-indan-2-carboxylate HCl;Methyl 2-amino-2,3-dihydro-1H-indene-2-carbox...;Methyl 2-aminoindan-2-carboxylate hydrochloride | | CAS: | 199330-64-8 | | MF: | C11H14ClNO2 | | MW: | 227.69 | | EINECS: | | | Product Categories: | | | Mol File: | 199330-64-8.mol |  |
| | 2-Amino-indan-2-carboxylic acid methyl ester hydrochloride Chemical Properties |
| storage temp. | Inert atmosphere,Room Temperature | | Appearance | White to off-white Solid | | InChI | InChI=1S/C11H13NO2.ClH/c1-14-10(13)11(12)6-8-4-2-3-5-9(8)7-11;/h2-5H,6-7,12H2,1H3;1H | | InChIKey | CTMQYQHFQQHLBO-UHFFFAOYSA-N | | SMILES | C1C=C2CC(C(=O)OC)(N)CC2=CC=1.Cl |
| | 2-Amino-indan-2-carboxylic acid methyl ester hydrochloride Usage And Synthesis |
| | 2-Amino-indan-2-carboxylic acid methyl ester hydrochloride Preparation Products And Raw materials |
|