| Company Name: |
commedx
|
| Tel: |
010-46598925 18519000250 |
| Email: |
zhanghu@commedx.com |
| Products Intro: |
Product Name:Propanoic acid, 2-(1,1-dimethylethoxy)-, (2R)- CAS:1704963-78-9 Purity:95% HPLC Package:1g;5g
|
|
| | Propanoic acid, 2-(1,1-dimethylethoxy)-, (2R)- Basic information |
| | Propanoic acid, 2-(1,1-dimethylethoxy)-, (2R)- Chemical Properties |
| Boiling point | 232.2±13.0 °C(Predicted) | | density | 1.004±0.06 g/cm3(Predicted) | | pka | 3.59±0.10(Predicted) | | InChI | InChI=1S/C7H14O3/c1-5(6(8)9)10-7(2,3)4/h5H,1-4H3,(H,8,9)/t5-/m1/s1 | | InChIKey | LLCMVSMCAHTTFZ-RXMQYKEDSA-N | | SMILES | C(O)(=O)[C@H](OC(C)(C)C)C |
| | Propanoic acid, 2-(1,1-dimethylethoxy)-, (2R)- Usage And Synthesis |
| | Propanoic acid, 2-(1,1-dimethylethoxy)-, (2R)- Preparation Products And Raw materials |
|