- BLATTELLAQUINONE
-
- $0.00 / 1KG
-
2022-01-18
- CAS:849762-24-9
- Min. Order: 1KG
- Purity: 97.3%
- Supply Ability: 100 tons
|
| | BLATTELLAQUINONE Basic information |
| Product Name: | BLATTELLAQUINONE | | Synonyms: | BLATTELLAQUINONE;(3,6-dioxocyclohexa-1,4-dienyl)methyl 3-methylbutanoate;(3,6-Dioxocyclohexa-1,4-dien-1-yl)Methyl 3-Methylbutanoate;Butanoic acid, 3-Methyl-, (3,6-dioxo-1,4-cyclohexadien-1-yl)Methyl ester;3-Methyl-,(3,6-dioxo-1,4-cyclohexadien-1-yl)Methyl ester;Gentisyl Quinone Isovalerate;(3,6-Dioxocyclohexa-1,4-dien-1-yl);100G;1KG | | CAS: | 849762-24-9 | | MF: | C12H14O4 | | MW: | 222.24 | | EINECS: | | | Product Categories: | Sex pheromone;pharmacetical | | Mol File: | 849762-24-9.mol |  |
| | BLATTELLAQUINONE Chemical Properties |
| Melting point | 46-47 °C(Solv: hexane (110-54-3)) | | Boiling point | 314.4±21.0 °C(Predicted) | | density | 1.160±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | color | Pale Brown to Very Dark Beige | | InChI | InChI=1S/C12H14O4/c1-8(2)5-12(15)16-7-9-6-10(13)3-4-11(9)14/h3-4,6,8H,5,7H2,1-2H3 | | InChIKey | JVMUMZYOAWLJQW-UHFFFAOYSA-N | | SMILES | C(OCC1C(=O)C=CC(=O)C=1)(=O)CC(C)C |
| | BLATTELLAQUINONE Usage And Synthesis |
| Uses | Blattellaquinone is a sex pheromone of German cockroach (Blatella germanica). |
| | BLATTELLAQUINONE Preparation Products And Raw materials |
|