|
|
| | tert-Butyl peroxyneodecanoate Basic information |
| Product Name: | tert-Butyl peroxyneodecanoate | | Synonyms: | tert-Butyl peroxyneodecanoate;t-Butyl peroxy neodecanoate;tert-butyl peroxyneodecanoate, <= 77% in solution;tert-butyl peroxyneodecanoate, technical pure;7,7-Dimethyloctaneperoxoic acid tert-butyl;Esperox 33M;Lupersol 10;Lupersol-10M-75 | | CAS: | 26748-41-4 | | MF: | C24H46O6 | | MW: | 430.61844 | | EINECS: | 247-955-1 | | Product Categories: | | | Mol File: | 26748-41-4.mol |  |
| | tert-Butyl peroxyneodecanoate Chemical Properties |
| density | 0.898[at 20℃] | | vapor pressure | 4.65Pa at 25℃ | | Water Solubility | 13mg/L at 25℃ | | InChI | InChI=1S/C14H26O4/c1-12(2,3)9-7-8-10-14(17-18-14)11(15)16-13(4,5)6/h7-10H2,1-6H3 | | InChIKey | JOIPTRRGOVGQPJ-UHFFFAOYSA-N | | SMILES | C(OC(C)(C)C)(=O)C1(OO1)CCCCC(C)(C)C | | LogP | 5 at 25℃ | | CAS DataBase Reference | 26748-41-4 | | EPA Substance Registry System | Neodecaneperoxoic acid, 1,1-dimethylethyl ester (26748-41-4) |
| RIDADR | 3115 | | HazardClass | 5.2 | | PackingGroup | II |
| | tert-Butyl peroxyneodecanoate Usage And Synthesis |
| Uses | t-Butyl Peroxyneodecanoate is useful as a low-temperature initiator for radicalcatalyzed
polymerization of vinyl monomers. | | General Description | tert-Butyl peroxyneodecanoate is sensitive to heat. Storage of tert-Butyl peroxyneodecanoate must be done so with stringent temperature control measures. It's explosion hazard is also mitigated by mixing the peroxide in an organic solvent slurry. Responders should try to identify solvent. | | Reactivity Profile | TERT-BUTYL PEROXYNEODECANOATE explodes with great violence when rapidly heated to a critical temperature; pure form is shock sensitive and detonable [Bretherick 1979 p. 602]. | | Flammability and Explosibility | Not classified |
| | tert-Butyl peroxyneodecanoate Preparation Products And Raw materials |
|