|
|
| | 2-bromo-3-methylpropiophenone Basic information | | Application |
| Product Name: | 2-bromo-3-methylpropiophenone | | Synonyms: | 2-bromo-3-methylpropiophenone;2-Bromo-1-m-tolyl-propan-1-one;2-Bromo-1-Phenyl-1-Butanone / 2-bromo-1-(3-methylphenyl)propan-1-one;1-Propanone, 2-bromo-1-(3-methylphenyl)-;2-Bromo-1-Phenyl-1-Butanone;2-Bromo-1-Phenyl-1-Butanone CAS 1451-83-8;2-Brom-3'-methylpropiophenon;2-bromo-1-(3-methylphenyl)propan-1-one | | CAS: | 1451-83-8 | | MF: | C10H11BrO | | MW: | 227.1 | | EINECS: | 208-460-6 | | Product Categories: | | | Mol File: | 1451-83-8.mol |  |
| | 2-bromo-3-methylpropiophenone Chemical Properties |
| Boiling point | 134-135 °C(Press: 8 Torr) | | density | 1.357±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C10H11BrO/c1-7-4-3-5-9(6-7)10(12)8(2)11/h3-6,8H,1-2H3 | | InChIKey | QGGNDYQVUDZPJB-UHFFFAOYSA-N | | SMILES | C(C1=CC=CC(C)=C1)(=O)C(Br)C |
| | 2-bromo-3-methylpropiophenone Usage And Synthesis |
| Application | 2-bromo-3-methylpropiophenone employed as an important intermediate for raw material for organic synthesis, agrochemical, pharmaceutical and dyestuff field. Also used as intermediate for 4-methylmethcathinone. | | Chemical Properties | White powder fine chemical intermediates. | | Agricultural Uses | 2-bromo-3-methylpropiophenone is a useful compound in the research. |
| | 2-bromo-3-methylpropiophenone Preparation Products And Raw materials |
|