- L-Leu-OBzlHCl
-
-
2026-09-24
- CAS:2462-35-3
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T+
|
| | L-Leucine benzyl ester hydrochloride Basic information |
| Product Name: | L-Leucine benzyl ester hydrochloride | | Synonyms: | (S)-benzyl 2-amino-4-methylpentanoate hydrochloride;L-Leucine, phenylMethyl ester, hydrochloride;(S)-benzyl 2-aMino-4-Methylpentanoate;L-Leu-OBzlHCl;benzyl(2S)-2-amino-4-methylpentanoate,hydrochloride;L-Leucine, phenylmethyl ester, hydrochloride (1:1);benzyl L-leucinate hydrochloride;H-L-Leu-OBzl.HCl | | CAS: | 2462-35-3 | | MF: | C13H19NO2.ClH | | MW: | 0 | | EINECS: | | | Product Categories: | | | Mol File: | 2462-35-3.mol |  |
| | L-Leucine benzyl ester hydrochloride Chemical Properties |
| Melting point | 129 °C(Solv: chloroform (67-66-3); cyclohexane (110-82-7)) | | storage temp. | Inert atmosphere,Room Temperature | | Appearance | White to off-white Solid | | Optical Rotation | -6.7°(C=1.0038 g/ml HCL) | | InChI | InChI=1/C13H19NO2.ClH/c1-10(2)8-12(14)13(15)16-9-11-6-4-3-5-7-11;/h3-7,10,12H,8-9,14H2,1-2H3;1H/t12-;/s3 | | InChIKey | HCYLOEGSAOVRIT-ZLBVLXFENA-N | | SMILES | C1(=CC=CC=C1)COC(=O)[C@@H](N)CC(C)C.Cl |&1:10,r| |
| | L-Leucine benzyl ester hydrochloride Usage And Synthesis |
| | L-Leucine benzyl ester hydrochloride Preparation Products And Raw materials |
|