1,3-Dioxolan-2-one, 4-(chloromethyl)- manufacturers
|
| | 1,3-Dioxolan-2-one, 4-(chloromethyl)- Basic information |
| Product Name: | 1,3-Dioxolan-2-one, 4-(chloromethyl)- | | Synonyms: | 1,3-Dioxolan-2-one, 4-(chloromethyl)-;4-Chloromethyl-1,3-dioxolan-2-one;Carbonic acid 3-chloropropylene ester;Nsc76035;CARBONIC ACID, CYCLIC 3-CHLOROPROPYLENE;2463-45-8 1,3-Dioxolan-2-one, 4-(chloromethyl)-;4-(chloromethyl)-1,3-dioxolane-2-one4-(chloromethyl)-1,3-dioxolan-2-one;chloromethyl tetrahydrofuranone | | CAS: | 2463-45-8 | | MF: | C4H5ClO3 | | MW: | 136.53 | | EINECS: | | | Product Categories: | | | Mol File: | 2463-45-8.mol |  |
| | 1,3-Dioxolan-2-one, 4-(chloromethyl)- Chemical Properties |
| Melting point | <-40 °C | | Boiling point | 181.03°C (rough estimate) | | density | 1.3647 (rough estimate) | | refractive index | 1.4320 (estimate) | | storage temp. | Storage temp. 2-8°C | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C4H5ClO3/c5-1-3-2-7-4(6)8-3/h3H,1-2H2 | | InChIKey | LFEAJBLOEPTINE-UHFFFAOYSA-N | | SMILES | O1CC(CCl)OC1=O | | CAS DataBase Reference | 2463-45-8 | | EPA Substance Registry System | 1,3-Dioxolan-2-one, 4-(chloromethyl)- (2463-45-8) |
| Toxicity | rat,LD50,oral,80mg/kg (80mg/kg),Contraception. Vol. 9, Pg. 451, 1974. |
| | 1,3-Dioxolan-2-one, 4-(chloromethyl)- Usage And Synthesis |
| Synthesis Reference(s) | The Journal of Organic Chemistry, 60, p. 725, 1995 DOI: 10.1021/jo00108a042 | | Safety Profile | Poison by ingestion.
Experimental reproductive effects. When
heated to decomposition it emits toxic
fumes of Cl-. |
| | 1,3-Dioxolan-2-one, 4-(chloromethyl)- Preparation Products And Raw materials |
|