| Company Name: |
Aikon International Limited
|
| Tel: |
025-66113011 19370895928 |
| Email: |
qzhang@aikonchem.com |
| Products Intro: |
Product Name:2-Chloro-4-(4-fluorophenyl)thiazole
CAS:42445-38-5
Purity:95+% Package:1g;5g;10g
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
| Products Intro: |
Product Name:2-Chloro-4-(4-fluorophenyl)thiazole
CAS:42445-38-5
Purity:95+% Package:1g Remarks:NULL
|
| Company Name: |
Bide Pharmatech Ltd.
|
| Tel: |
400-1647117 13681763483 |
| Email: |
product02@bidepharm.com |
| Products Intro: |
Product Name:2-Chloro-4-(4-fluorophenyl)thiazole
CAS:42445-38-5
Purity:95% Package:100mg;250mg;1g;5g;10g Remarks:BD72833
|
|
| | 2-CHLORO-4-(4-FLUOROPHENYL)-1,3-THIAZOLE Basic information |
| Product Name: | 2-CHLORO-4-(4-FLUOROPHENYL)-1,3-THIAZOLE | | Synonyms: | 2-chloro-4-(4-fluorophenyl)-1,3-thiazole(SALTDATA: FREE);2-Chloro-4-(4-fluorophenyl)thiazole≥ 99.9% (HPLC);JR-6630, 2-Chloro-4-(4-fluorophenyl)thiazole, 97%;Thiazole, 2-chloro-4-(4-fluorophenyl)-;2-CHLORO-4-(4-FLUOROPHENYL)-1,3-THIAZO | | CAS: | 42445-38-5 | | MF: | C9H5ClFNS | | MW: | 213.66 | | EINECS: | | | Product Categories: | | | Mol File: | 42445-38-5.mol |  |
| | 2-CHLORO-4-(4-FLUOROPHENYL)-1,3-THIAZOLE Chemical Properties |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C | | form | solid | | InChI | 1S/C9H5ClFNS/c10-9-12-8(5-13-9)6-1-3-7(11)4-2-6/h1-5H | | InChIKey | WXAGIWOTZPAABI-UHFFFAOYSA-N | | SMILES | ClC1=NC(C(C=C2)=CC=C2F)=CS1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Dam. 1 |
| | 2-CHLORO-4-(4-FLUOROPHENYL)-1,3-THIAZOLE Usage And Synthesis |
| Chemical Properties | White flakes |
| | 2-CHLORO-4-(4-FLUOROPHENYL)-1,3-THIAZOLE Preparation Products And Raw materials |
|