| Company Name: |
Merck KGaA |
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Company Name: |
SIGMA-RBI |
| Tel: |
800 736 3690 (Orders) |
| Email: |
|
|
| | 1,4-Bis(trifluoromethyl)benzene-ring-13C6 Basic information |
| | 1,4-Bis(trifluoromethyl)benzene-ring-13C6 Chemical Properties |
| Boiling point | 116 °C(lit.) | | density | 1.419 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.379(lit.) | | Fp | 71 °F | | InChI | 1S/C8H4F6/c9-7(10,11)5-1-2-6(4-3-5)8(12,13)14/h1-4H/i1+1,2+1,3+1,4+1,5+1,6+1 | | InChIKey | PDCBZHHORLHNCZ-IDEBNGHGSA-N | | SMILES | FC(F)(F)[13c]1[13cH][13cH][13c]([13cH][13cH]1)C(F)(F)F |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-10 | | Safety Statements | 26-36-36/37/39-16 | | RIDADR | UN 1993 3/PG 2 | | WGK Germany | 3 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Irrit. 2 Flam. Liq. 2 Skin Irrit. 2 STOT SE 3 |
| | 1,4-Bis(trifluoromethyl)benzene-ring-13C6 Usage And Synthesis |
| Uses | 1,4-Bis(trifluoromethyl)benzene-13C6 is an intermediate in the synthesis of Dutasteride-13C6 (D735002), which is a labeled Dutasteride (D735000). Dutasteride is a dual inhibitor of 5α-reductase isoenzymes type 1 and 2; structurally related to Finasteride (F342000). Dutasteride is used in the treatment of benign prostatic hyperplasia. |
| | 1,4-Bis(trifluoromethyl)benzene-ring-13C6 Preparation Products And Raw materials |
|