| Company Name: |
Chengdu Alfa Biotechnology Co.,Ltd. Gold
|
| Tel: |
028-028-85142057 19983342022 |
| Email: |
3005359975@qq.com |
| Products Intro: |
Product Name:Adoxosidic acid
CAS:84375-46-2
Purity:>98%(HPLC) Package:10mg/RMB 2450 Remarks:10mg/2450
|
| Company Name: |
BioBioPha Co., Ltd.
|
| Tel: |
0871-65217109 13211707573; |
| Email: |
y.liu@mail.biobiopha.com |
| Products Intro: |
Product Name:Adoxosidic acid
CAS:84375-46-2
Purity:98.0% Package:5mg Remarks:BBP04840
|
|
| | Adoxosidic acid Basic information |
| Product Name: | Adoxosidic acid | | Synonyms: | Adoxosidic acid;Cyclopenta[c]pyran-4-carboxylic acid, 1-(β-D-glucopyranosyloxy)-1,4a,5,6,7,7a-hexahydro-7-(hydroxymethyl)-, (1S,4aS,7S,7aS)- | | CAS: | 84375-46-2 | | MF: | C16H24O10 | | MW: | 376.36 | | EINECS: | | | Product Categories: | | | Mol File: | 84375-46-2.mol |  |
| | Adoxosidic acid Chemical Properties |
| Boiling point | 654.3±55.0 °C(Predicted) | | density | 1.60±0.1 g/cm3(Predicted) | | pka | 4.59±0.60(Predicted) | | form | Solid | | color | White to off-white | | InChIKey | XJOPDXRZTFGTIW-YPXIHJIJNA-N | | SMILES | O([C@@]1([H])[C@@H]([C@@H](O)[C@H](O)[C@@H](CO)O1)O)[C@@H]1OC=C(C(=O)O)[C@@]2([H])CC[C@H](CO)[C@@]12[H] |&1:1,3,4,6,8,13,20,24,27,r| |
| | Adoxosidic acid Usage And Synthesis |
| Uses | Adoxosidic acid is a SERT enhancer can be extracted from N. jatamansi and can be used in antidepressant research[1]. | | References | [1] Li R, et al. Antidepressant activities and regulative effects on serotonin transporter of Nardostachys jatamansi DC. J Ethnopharmacol. 2021 Mar 25;268:113601. DOI:10.1016/j.jep.2020.113601 |
| | Adoxosidic acid Preparation Products And Raw materials |
|