|
|
| | Methyl 3-formyl-4-nitrobenzoate Basic information |
| | Methyl 3-formyl-4-nitrobenzoate Chemical Properties |
| Melting point | 72-76 °C (lit.) | | Boiling point | 385.1±37.0 °C(Predicted) | | density | 1.386 | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | InChI | InChI=1S/C9H7NO5/c1-15-9(12)6-2-3-8(10(13)14)7(4-6)5-11/h2-5H,1H3 | | InChIKey | JHFSCEMUDKRPID-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C1=CC=C([N+]([O-])=O)C(C=O)=C1 | | CAS DataBase Reference | 148625-35-8 |
| | Methyl 3-formyl-4-nitrobenzoate Usage And Synthesis |
| Uses | Methyl 3-Formyl-4-nitrobenzoate is a useful research chemical used in the preparation of ring-fused aminals via α-amination of cyclic amines. |
| | Methyl 3-formyl-4-nitrobenzoate Preparation Products And Raw materials |
|