| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
|
| | 2-Thiophenecarboxylic acid, 4-bromo-3-fluoro-, methyl ester Basic information |
| Product Name: | 2-Thiophenecarboxylic acid, 4-bromo-3-fluoro-, methyl ester | | Synonyms: | Methyl 4-bromo-3-fluoro-2-thiophenecarboxylate;Methyl 4-broMo-3-fluorothiophene-2-carboxylate;2-Thiophenecarboxylic acid, 4-bromo-3-fluoro-, methyl ester;4-Bromo-3-fluoro-2-thiophenecarboxylic acid methyl ester;4-Bromo-3-fluoro-thiophene-2-carboxylic acid methyl ester | | CAS: | 395664-56-9 | | MF: | C6H4BrFO2S | | MW: | 239.06 | | EINECS: | 200-589-5 | | Product Categories: | | | Mol File: | 395664-56-9.mol |  |
| | 2-Thiophenecarboxylic acid, 4-bromo-3-fluoro-, methyl ester Chemical Properties |
| Boiling point | 267.1±40.0 °C(Predicted) | | density | 1.742±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C6H4BrFO2S/c1-10-6(9)5-4(8)3(7)2-11-5/h2H,1H3 | | InChIKey | WOIOEHSFRAGWFF-UHFFFAOYSA-N | | SMILES | C1(C(OC)=O)SC=C(Br)C=1F |
| | 2-Thiophenecarboxylic acid, 4-bromo-3-fluoro-, methyl ester Usage And Synthesis |
| | 2-Thiophenecarboxylic acid, 4-bromo-3-fluoro-, methyl ester Preparation Products And Raw materials |
|