| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2,2,6,6-Tetramethyl-4-piperidyl methacrylate Basic information |
| Product Name: | 2,2,6,6-Tetramethyl-4-piperidyl methacrylate | | Synonyms: | METHACRYLIC ACID 2,2,6,6-TETRAMETHYL-4-PIPERIDYL ESTER;2-Propenoicacid,2-methyl-,2,2,6,6-tetramethyl-4-piperidinylester;2,2,6,6-Tetramethyl-4-piperidyl Methacrylate (stabilized with MEHQ);4-(Methacryloyloxy)-2,2,6,6-tetramethylpiperidine;4-Methacryloyloxy-2,2,6,6-tetramethylpiperidine;Fancryl FA-712HM;2,2,6,6-Tetramethylpiperidyl methacrylate;2,2,6,6-Tetramethyl-4-piperidyl Methacrylat | | CAS: | 31582-45-3 | | MF: | C13H23NO2 | | MW: | 225.33 | | EINECS: | 250-718-5 | | Product Categories: | Amines;Heterocycles;Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | 31582-45-3.mol |  |
| | 2,2,6,6-Tetramethyl-4-piperidyl methacrylate Chemical Properties |
| Melting point | 61 °C | | Boiling point | 273.0±33.0 °C(Predicted) | | density | 0.97±0.1 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 10.13±0.10(Predicted) | | color | White | | InChI | InChI=1S/C13H23NO2/c1-9(2)11(15)16-10-7-12(3,4)14-13(5,6)8-10/h10,14H,1,7-8H2,2-6H3 | | InChIKey | UFLXKQBCEYNCDU-UHFFFAOYSA-N | | SMILES | C(OC1CC(C)(C)NC(C)(C)C1)(=O)C(C)=C | | CAS DataBase Reference | 31582-45-3 |
| | 2,2,6,6-Tetramethyl-4-piperidyl methacrylate Usage And Synthesis |
| Chemical Properties | White Waxy Solid | | Uses | 2,2,6,6-TetraMethyl-4-piperidyl Methacrylate is used as cholesterol-lowering agent. | | Uses | It is used as cholesterol-lowering agent. |
| | 2,2,6,6-Tetramethyl-4-piperidyl methacrylate Preparation Products And Raw materials |
|