|
|
| | D-ALPHA-TOCOTRIENOL Basic information |
| Product Name: | D-ALPHA-TOCOTRIENOL | | Synonyms: | D-a-Tocotrienol;D-ALPHA-TOCOTRIENOL;(2R,3'E,7'E)-alpha-Tocotrienol;(R)-alpha-Tocotrienol;2H-1-Benzopyran-6-ol, 3,4-dihydro-2,5,7,8-tetramethyl-2-(4,8,12-trimethyl-3,7,11-tridecatrienyl)-, [R-(E,E)]-;2H-1-Benzopyran-6-ol, 3,4-dihydro-2,5,7,8-tetramethyl-2-[(3E,7E)-4,8,12-trimethyl-3,7,11-tridecatrienyl]-, (2R)-;2H-1-Benzopyran-6-ol, 3,4-dihydro-2,5,7,8-tetramethyl-2-[(3E,7E)-4,8,12-trimethyl-3,7,11-tridecatrienyl]-, (2R)- (9ci);(-)-alpha-Tocotrienol | | CAS: | 58864-81-6 | | MF: | C29H44O2 | | MW: | 424.66 | | EINECS: | | | Product Categories: | | | Mol File: | 58864-81-6.mol |  |
| | D-ALPHA-TOCOTRIENOL Chemical Properties |
| Melting point | 30-31 °C | | Boiling point | 541.7±50.0 °C(Predicted) | | density | 0.960±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 11.40±0.40(Predicted) | | form | Oil | | color | Yellow to Dark Yellow | | biological source | Elaeis guineensis | | Stability: | Light Sensitive | | InChIKey | RZFHLOLGZPDCHJ-XZXLULOTSA-N | | SMILES | [C@@]1(C)(CC/C=C(\C)/CC/C=C(\C)/CC/C=C(\C)/C)OC2=C(C)C(C)=C(O)C(C)=C2CC1 | | LogP | 10.760 (est) |
| | D-ALPHA-TOCOTRIENOL Usage And Synthesis |
| Uses | D-alpha-Tocotrienol is an antioxidant shown to block glutamate-induced cell death in neuronal cells. | | Definition | ChEBI: Alpha-tocotrienol is a tocotrienol that is chroman-6-ol substituted by methyl groups at positions 2, 5, 7 and 8 and a farnesyl chain at position 2. It has been found in palm oil derived from Elaeis guineensis. It has a role as a neuroprotective agent, a plant metabolite, a ferroptosis inhibitor and a human metabolite. It is a tocotrienol and a vitamin E. | | IC 50 | Human Endogenous Metabolite |
| | D-ALPHA-TOCOTRIENOL Preparation Products And Raw materials |
|