|
|
| | 4-(3-ISOPROPYL-1,2,4-OXADIAZOL-5-YL)PIPERIDINE Basic information |
| Product Name: | 4-(3-ISOPROPYL-1,2,4-OXADIAZOL-5-YL)PIPERIDINE | | Synonyms: | 3-Isopropyl-5-(piperidin-4-yl)-1,2,4-oxadiazole;4-(3-Isopropyl-1,2,4-oxadiazol-5-yl)piperidine;4-(3-isopropyl-1,2,4-oxadiazol-5-yl)piperidine(SALTDATA: HCl);5-(4-piperidinyl)-3-propan-2-yl-1,2,4-oxadiazole;Piperidine, 4-[3-(1-methylethyl)-1,2,4-oxadiazol-5-yl]- | | CAS: | 733748-92-0 | | MF: | C10H17N3O | | MW: | 195.26 | | EINECS: | | | Product Categories: | | | Mol File: | 733748-92-0.mol |  |
| | 4-(3-ISOPROPYL-1,2,4-OXADIAZOL-5-YL)PIPERIDINE Chemical Properties |
| Boiling point | 316.9±52.0 °C(Predicted) | | density | 1.049±0.06 g/cm3(Predicted) | | refractive index | 1.4860 | | storage temp. | 2-8°C | | form | solid | | pka | 9.58±0.10(Predicted) | | Appearance | Colorless to light yellow Liquid | | InChI | 1S/C10H17N3O/c1-7(2)9-12-10(14-13-9)8-3-5-11-6-4-8/h7-8,11H,3-6H2,1-2H3 | | InChIKey | QDRJZNBKSMAEIE-UHFFFAOYSA-N | | SMILES | N1CCC(CC1)c2nc(n[o]2)C(C)C | | CAS DataBase Reference | 733748-92-0 |
| Hazard Codes | Xi,T | | Risk Statements | 25 | | Safety Statements | 45 | | WGK Germany | 3 | | HazardClass | IRRITANT | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 4-(3-ISOPROPYL-1,2,4-OXADIAZOL-5-YL)PIPERIDINE Usage And Synthesis |
| | 4-(3-ISOPROPYL-1,2,4-OXADIAZOL-5-YL)PIPERIDINE Preparation Products And Raw materials |
|