|
|
| | (1,2-Bis(Ethoxycarbonyl)Hydrazineyl)Triphenylphosphonium Basic information |
| Product Name: | (1,2-Bis(Ethoxycarbonyl)Hydrazineyl)Triphenylphosphonium | | Synonyms: | (1,2-Bis(Ethoxycarbonyl)Hydrazineyl)Triphenylphosphonium;1,2-Bis(ethoxycarbonyl)hydrazinyl]triphenylphosphonium Trifluoromethanesulfonate;Phosphorus(1+), (1,2-diethyl 1,2-hydrazinedicarboxylato-κN1)triphenyl-, (T-4)-, 1,1,1-trifluoromthanesulfonate (1:1);(1,2-bis(ethoxycarbonyl)hydrazinyl)triphenylphosphonium trifluoromethanesulfonate（BEHT triflate）;BEHT;BEHT triflate | | CAS: | 3075704-21-8 | | MF: | C24H26N2O4P.CF3O3S | | MW: | 586.52 | | EINECS: | | | Product Categories: | | | Mol File: | 3075704-21-8.mol |  |
| | (1,2-Bis(Ethoxycarbonyl)Hydrazineyl)Triphenylphosphonium Chemical Properties |
| storage temp. | 2-8°C, stored under nitrogen | | Appearance | White to off-white Solid | | InChIKey | HYMHTRAMEOGPDA-UHFFFAOYSA-N | | SMILES | [P+](C1C=CC=CC=1)(C1C=CC=CC=1)(C1C=CC=CC=1)N(C(=O)OCC)NC(=O)OCC.C(F)(F)(F)S([O-])(=O)=O |
| | (1,2-Bis(Ethoxycarbonyl)Hydrazineyl)Triphenylphosphonium Usage And Synthesis |
| Uses | Direct conversion of alcohols into amines using (1,2-Bis(Ethoxycarbonyl)Hydrazineyl)Triphenylphosium triflate (BEHT triflate)[1].
 | | References |
[1] Bechara, W. S., Sagamanova, I. K., Thai-Savard, L., Dauphinais, M., Régnier, S., Noël, C., Jarvis, S. B. D., & Charette, A. B. (2025). Universal Reagent for Mild and Stereospecific Nucleophilic Substitution of Alcohols with Amines. Angewandte Chemie, 137 13. https://doi.org/10.1002/ange.202420312
|
| | (1,2-Bis(Ethoxycarbonyl)Hydrazineyl)Triphenylphosphonium Preparation Products And Raw materials |
|