| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 18918157536; |
| Email: |
sales8178@energy-chemical.com |
|
| | 4-Amylcyclohexanol Basic information |
| Product Name: | 4-Amylcyclohexanol | | Synonyms: | 4-pentyl-cyclohexano;4-n-Pentylcyclohexanol, cis and trans, 98%;4-Amylcyclohexanol (cis- and trans- mixture);4-Amylcyclohexanol (cis- and trans- mixture);4-PENTYLCYCLOHEXANOL;4-Amylcyclohexanol (cis- and trans- mixture)>;Cyclohexanol, 4-pentyl-;4-Amylcyclohexanol (cis+trans) | | CAS: | 54410-90-1 | | MF: | C11H22O | | MW: | 170.29 | | EINECS: | | | Product Categories: | | | Mol File: | 54410-90-1.mol |  |
| | 4-Amylcyclohexanol Chemical Properties |
| Boiling point | 88 °C | | density | 0.90 | | refractive index | 1.4640-1.4680 | | storage temp. | Sealed in dry,Room Temperature | | form | clear liquid | | pka | 15.34±0.40(Predicted) | | color | Colorless to Light yellow | | InChI | InChI=1S/C11H22O/c1-2-3-4-5-10-6-8-11(12)9-7-10/h10-12H,2-9H2,1H3 | | InChIKey | VHWGPISIUNUREA-UHFFFAOYSA-N | | SMILES | C1(O)CCC(CCCCC)CC1 | | CAS DataBase Reference | 54410-90-1 |
| RTECS | GW0680000 | | HS Code | 2906190090 |
| | 4-Amylcyclohexanol Usage And Synthesis |
| Chemical Properties | Colorless liquid |
| | 4-Amylcyclohexanol Preparation Products And Raw materials |
|