4-Acetyl-benzoic acid tert-butyl ester manufacturers
|
| | 4-Acetyl-benzoic acid tert-butyl ester Basic information |
| Product Name: | 4-Acetyl-benzoic acid tert-butyl ester | | Synonyms: | 4-Acetyl-benzoic acid tert-butyl ester;tert-Butyl 4-acetylbenzoate;Benzoic acid, 4-acetyl-, 1,1-dimethylethyl ester;ert-Butyl 4-acetylbenzoate;1,1-Dimethylethyl 4-acetylbenzoate | | CAS: | 105580-41-4 | | MF: | C13H16O3 | | MW: | 220.26 | | EINECS: | | | Product Categories: | | | Mol File: | 105580-41-4.mol |  |
| | 4-Acetyl-benzoic acid tert-butyl ester Chemical Properties |
| Melting point | 56.5-57.5 °C | | Boiling point | 90-100 °C(Press: 0.1 Torr) | | density | 1.056±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | InChI | InChI=1S/C13H16O3/c1-9(14)10-5-7-11(8-6-10)12(15)16-13(2,3)4/h5-8H,1-4H3 | | InChIKey | QXQXBZLXIAUIBG-UHFFFAOYSA-N | | SMILES | C(OC(C)(C)C)(=O)C1=CC=C(C(C)=O)C=C1 |
| | 4-Acetyl-benzoic acid tert-butyl ester Usage And Synthesis |
| | 4-Acetyl-benzoic acid tert-butyl ester Preparation Products And Raw materials |
|