| Company Name: |
Henan yingchuang Gold |
| Tel: |
16650708709 |
| Email: |
hnyingchuang@163.com |
| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
(-)-1,2-Bis((2R,5R)-2,5-diphenylphospholano)ethane manufacturers
|
| | (-)-1,2-Bis((2R,5R)-2,5-diphenylphospholano)ethane Basic information |
| Product Name: | (-)-1,2-Bis((2R,5R)-2,5-diphenylphospholano)ethane | | Synonyms: | (-)-1,2-Bis((2R,5R)-2,5-diphenylphospholano)ethane,min.98%(R,R)-Ph-BPE;(-)-1,2-Bis((2R,5R)-2,5-diphenylphospholano)ethane, Min. 95% (R,R)-Ph-BPE;(2R,2'R,5R,5'R)-1,1'-(1,2-Ethanediyl)bis[2,5-diphenylphospholane];(-)-1,2-Bis((2R,5R)-2,5-diphenylphospholano)ethane, min. 95%;1,2-Bis[(2R,5R)-2,5-diphenyl-1-phospholanyl]ethane, 97+%;(-)-1,2-BIS((2R,5R)-2,5-DIPHENYLPHOSPHOLANO)ETHANE, KANATA PURITY;(-)-1,2-BIS((2R,5R)-2,5-DIPHENYLPHOSPHOLANO)ETHANE,MIN.95%(R,R)-PH-BPE;(-)-1,2-Bis((2R,5R)-2,5-diphenylphospholano)ethane, 97+% | | CAS: | 528565-79-9 | | MF: | C34H36P2 | | MW: | 506.6 | | EINECS: | | | Product Categories: | Chiral Phosphine;DuPhos/BPE;Chiral Catalysts, Ligands, and Reagents;Privileged Ligands and Complexes;organophosphine ligand | | Mol File: | 528565-79-9.mol |  |
| | (-)-1,2-Bis((2R,5R)-2,5-diphenylphospholano)ethane Chemical Properties |
| Melting point | 144°C | | alpha | -182.7° (c 1.0, CH2Cl2) | | Boiling point | 654.2±55.0 °C(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | solid | | color | white | | Water Solubility | Sparingly soluble in water.(3.2E-5g/L) (25°C | | Sensitive | Air Sensitive | | InChIKey | VHHAZLMVLLIMHT-YFRBGRBWSA-N | | SMILES | C(P1[C@@H](C2=CC=CC=C2)CC[C@@H]1C1=CC=CC=C1)CP1[C@@H](C2=CC=CC=C2)CC[C@@H]1C1=CC=CC=C1 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | (-)-1,2-Bis((2R,5R)-2,5-diphenylphospholano)ethane Usage And Synthesis |
| | (-)-1,2-Bis((2R,5R)-2,5-diphenylphospholano)ethane Preparation Products And Raw materials |
|