|
|
| | 4-Octylphenethyl methanesulfonate Basic information |
| Product Name: | 4-Octylphenethyl methanesulfonate | | Synonyms: | 2-(4-Octylphenyl)ethyl 1-Methanesulfonate;4-Octylphenethyl methanesulfote;4-Octylphenethyl methanesulfonate;Benzeneethanol, 4-octyl-, 1-methanesulfonate;4-octyl-Benzeneethanol 1-methanesulfonate;Fingolimod Impurity 51;|2-(4-octylphenyl)ethyl methanesulfonate | | CAS: | 162358-06-7 | | MF: | C17H28O3S | | MW: | 312.47 | | EINECS: | | | Product Categories: | | | Mol File: | 162358-06-7.mol |  |
| | 4-Octylphenethyl methanesulfonate Chemical Properties |
| Boiling point | 454.8±24.0 °C(Predicted) | | density | 1.048±0.06 g/cm3 (20 ºC 760 Torr) | | storage temp. | Refrigerator | | solubility | Chloroform, Ethyl Acetate | | form | Solid | | color | Orange | | InChI | InChI=1S/C17H28O3S/c1-3-4-5-6-7-8-9-16-10-12-17(13-11-16)14-15-20-21(2,18)19/h10-13H,3-9,14-15H2,1-2H3 | | InChIKey | JDFKJMYGKUSROO-UHFFFAOYSA-N | | SMILES | C1(CCOS(C)(=O)=O)=CC=C(CCCCCCCC)C=C1 |
| | 4-Octylphenethyl methanesulfonate Usage And Synthesis |
| Chemical Properties | Orange Solid | | Uses | An intermediate in the preparation of FTY720-d4 (F805002), a labelled derivative of ISP-1 (myriocin), a fungal metabolite of the Chinese herb Iscaria sinclarii as well as a structural analogue of Sphi
ngosine. | | Uses | An intermediate in the preparation of FTY720-d4 (F805002), a labelled derivative of ISP-1 (myriocin), a fungal metabolite of the Chinese herb Iscaria sinclarii as well as a structural analogue of Sphingosine. |
| | 4-Octylphenethyl methanesulfonate Preparation Products And Raw materials |
|