|
|
| | 2-(4-ethyl-3-iodophenyl)-2-Methylpropanoic acid Basic information |
| Product Name: | 2-(4-ethyl-3-iodophenyl)-2-Methylpropanoic acid | | Synonyms: | 2-(4-ethyl-3-iodophenyl)-2-Methylpropanoic acid;2-(4-ethyl-3-iodophenyl)-2-Methylpropanoic acid-7;4-Ethyl-3-iodo-α,α-dimethylbenzeneacetic acid;4-Ethyl-3-iodo-alpha,alpha-dimethylbenzeneacetic acid;2-(3-Iodo-4-ethylphenyl)-2-methylpropionic acid;Alecensa intermediate;Alectinib Impurity 14;Benzeneacetic acid, 4-ethyl-3-iodo-α,α-dimethyl- | | CAS: | 1256584-73-2 | | MF: | C12H15IO2 | | MW: | 318.15 | | EINECS: | | | Product Categories: | 1256584-73-2 | | Mol File: | 1256584-73-2.mol |  |
| | 2-(4-ethyl-3-iodophenyl)-2-Methylpropanoic acid Chemical Properties |
| Boiling point | 369.6±27.0 °C(Predicted) | | density | 1.547±0.06 g/cm3(Predicted) | | pka | 4.32±0.11(Predicted) | | InChI | InChI=1S/C12H15IO2/c1-4-8-5-6-9(7-10(8)13)12(2,3)11(14)15/h5-7H,4H2,1-3H3,(H,14,15) | | InChIKey | RUVGXZCQYVEAKQ-UHFFFAOYSA-N | | SMILES | C(O)(=O)C(C1=CC=C(CC)C(I)=C1)(C)C |
| | 2-(4-ethyl-3-iodophenyl)-2-Methylpropanoic acid Usage And Synthesis |
| Uses | 2-(4-ethyl-3-iodophenyl)-2-Methylpropanoic acid is an intermediate of Alectinib (C183360), a highly selective and potent anaplastic lymphoma kinase (ALK) inhibitor capable of blocking the resistant gatekeeper mutant, which results in reduced cell growth.
| | Synthesis | 2-(4-ethyl-3-iodophenyl)-2-Methylpropanoic acid is prepared by reacting 4-Ethyl-α,α-dimethylbenzeneacetic acid with N-Iodosuccinimide in Acetic acid for 2h.
 |
| | 2-(4-ethyl-3-iodophenyl)-2-Methylpropanoic acid Preparation Products And Raw materials |
|