| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | N,N,N',N'-Tetramethyl-O-(N-succinimidyl)uronium hexafluorophosphate Basic information |
| Product Name: | N,N,N',N'-Tetramethyl-O-(N-succinimidyl)uronium hexafluorophosphate | | Synonyms: | 2-SUCCINIMIDO-1,1,3,3-TETRAMETHYLURONIM HEXAFLUOROPHOSPHATE;2-SUCCINIMIDO-1,1,3,3-TETRAMETHYLURONIUM HEXAFLUOROPHOSPHATE;O-(N-Succinimidyl)-1,1,3,3-tetramethyluronium hexafluorophosphate;O-(N-SUCCINIMIDYL)-N,N,N',N'-TETRA-;O-(N-Succinimidyl)-N,N,N',N'-tetramethyluroniumhe;o-(n-succinimidyl)-n,n,n',n'-tetra-methyluroniumpf6;HSTU O-(N-SUCCINIMIDYL)-1,1,3,3-TETRAMETHYLURONIUM HEXAFLUOROPHOSPHATE;HSTU (O-(N-SUCCINIMIDYL)-N,N,N'',N''-TETRAMETHYL URONIUM HEXAFLUORO PHOSPHATE) | | CAS: | 265651-18-1 | | MF: | C9H16F6N3O3P | | MW: | 359.21 | | EINECS: | | | Product Categories: | Coupling Reagent | | Mol File: | 265651-18-1.mol |  |
| | N,N,N',N'-Tetramethyl-O-(N-succinimidyl)uronium hexafluorophosphate Chemical Properties |
| Melting point | 218-221°C | | storage temp. | -20°C | | solubility | Soluble in acetonitrile 0.5 g/mL. | | form | Powder or Crystalline Powder | | color | White to off-white | | Sensitive | Moisture Sensitive | | Major Application | peptide synthesis | | InChI | InChI=1S/C9H16N3O3.F6P/c1-10(2)9(11(3)4)15-12-7(13)5-6-8(12)14;1-7(2,3,4,5)6/h5-6H2,1-4H3;/q+1;-1 | | InChIKey | STWZCCVNXFLDDD-UHFFFAOYSA-N | | SMILES | [P+5]([F-])([F-])([F-])([F-])([F-])[F-].O(N1C(CCC1=O)=O)/C(=[N+](\C)/C)/N(C)C | | CAS DataBase Reference | 265651-18-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-60-37 | | WGK Germany | 3 | | HS Code | 29280000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | N,N,N',N'-Tetramethyl-O-(N-succinimidyl)uronium hexafluorophosphate Usage And Synthesis |
| Chemical Properties | White to off-white crystalline powder | | Uses | Coupling reagent for peptide synthesis and the formation of other amides. Reactant for synthesis of liposomal contrast agents for magnetic resonance imaging, synthesis of protein labeling molecules, synthesis of thiol-reactive Cy5 derivatives. | | Uses | Coupling reagent for peptide synthesis and the formation of other amides. Yield in aqueous solution is excellent too. | | General Description | N,N,N′,N′-Tetramethyl-O-(N-succinimidyl)uronium hexafluorophosphate can be used to prepare N-succinimidyl 4-[18F]fluorobenzoate ([18F]-SFB), a prosthetic group for the fluorination of biomolecules for PET imaging. | | reaction suitability | reaction type: Coupling Reactions |
| | N,N,N',N'-Tetramethyl-O-(N-succinimidyl)uronium hexafluorophosphate Preparation Products And Raw materials |
|