2-(Diphenylmethyl)-quinuclidin-3-one manufacturers
|
| | 2-(Diphenylmethyl)-quinuclidin-3-one Basic information | | Uses |
| Product Name: | 2-(Diphenylmethyl)-quinuclidin-3-one | | Synonyms: | 2-benzhydrylquinuclidin-3-one(WXG03235);1-Azabicyclo[2.2.2]octan-3-one, 2-(diphenylmethyl)-;2-benzhydryl-1-azabicyclo[2.2.2]octan-3-one;Maropitant internate 1;2-benzhydrylquinuclidin-3-one;Maropitant intermediate 2;2-(Diphenylmethyl)-1-azabicyclo[2,2,2]octan-3-one;3-Benzhydrylquinuclidine-3-one | | CAS: | 32531-66-1 | | MF: | C20H21NO | | MW: | 291.39 | | EINECS: | 608-752-7 | | Product Categories: | | | Mol File: | 32531-66-1.mol |  |
| | 2-(Diphenylmethyl)-quinuclidin-3-one Chemical Properties |
| Boiling point | 432.8±28.0 °C(Predicted) | | density | 1.17±0.1 g/cm3(Predicted) | | pka | 6.19±0.40(Predicted) | | Water Solubility | 26mg/L at 25℃ | | InChI | InChI=1S/C20H21NO/c22-20-17-11-13-21(14-12-17)19(20)18(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-10,17-19H,11-14H2 | | InChIKey | PQSXXBSNZJLXMQ-UHFFFAOYSA-N | | SMILES | N12CCC(CC1)C(=O)C2C(C1=CC=CC=C1)C1=CC=CC=C1 | | LogP | 4.36 |
| | 2-(Diphenylmethyl)-quinuclidin-3-one Usage And Synthesis |
| Uses | 2-Diphenylmethylquinine-3-one is a ketone derivative that can be used as a pharmaceutical intermediate. |
| | 2-(Diphenylmethyl)-quinuclidin-3-one Preparation Products And Raw materials |
|