3-[2-N-(Biotinyl)aminoethyldithio]propanoic acid manufacturers
- Biotin-SS-COOH
-
-
2025-06-07
- CAS:104582-29-8
- Min. Order: 100mg
- Purity: >95.00%
- Supply Ability: 100mg
|
| | 3-[2-N-(Biotinyl)aminoethyldithio]propanoic acid Basic information |
| Product Name: | 3-[2-N-(Biotinyl)aminoethyldithio]propanoic acid | | Synonyms: | 3-[[2-[[5-[(3aS,4S,6aR)-Hexahydro-2-oxo-1H-thieno[3,4-d]iMidazol-4-yl]-1-oxopentyl]aMino]ethyl]dithio]propanoic Acid;Propanoic acid, 3-[[2-[[5-[(3aS,4S,6aR)-hexahydro-2-oxo-1H-thieno[3,4-d]imidazol-4-yl]-1-oxopentyl]amino]ethyl]dithio]-;3-((2-(5-((3aS,4S,6aR)-2-oxohexahydro-1H-thieno[3,4-d]imidazol-4-yl)pentanamido)ethyl)disulfanyl)propanoic acid;Biotin-SS-COOH;thyldithio]propanoic acid;3-[2-N-(Biotinyl)amin&œ3-[2-N-(Biotinyl)aminoethyldithio]propanoic acid;3-[2-N-(Biotinyl)aminoethyldithio]propanoic acid | | CAS: | 104582-29-8 | | MF: | C15H25N3O4S3 | | MW: | 407.57 | | EINECS: | | | Product Categories: | Biotin Derivatives;Cross Linking Reagents | | Mol File: | Mol File | ![3-[2-N-(Biotinyl)aminoethyldithio]propanoic acid Structure](StructureFile/ChemBookStructure7/GIF/CB2425667.gif) |
| | 3-[2-N-(Biotinyl)aminoethyldithio]propanoic acid Chemical Properties |
| Melting point | 173-175°C | | Boiling point | 772.4±60.0 °C(Predicted) | | density | 1.318±0.06 g/cm3(Predicted) | | storage temp. | -20°C Freezer | | solubility | Aqueous Base (Slightly), DMSO (Slightly) | | form | Solid | | pka | 4.25±0.10(Predicted) | | color | White to Beige | | InChI | 1S/C15H25N3O4S3/c19-12(16-6-8-25-24-7-5-13(20)21)4-2-1-3-11-14-10(9-23-11)17-15(22)18-14/h10-11,14H,1-9H2,(H,16,19)(H,20,21)(H2,17,18,22)/t10-,11-,14-/m0/s1 | | InChIKey | LUKYYZVIDAWYMZ-MJVIPROJSA-N | | SMILES | S1[C@H]([C@H]2NC(=O)N[C@H]2C1)CCCCC(=O)NCCSSCCC(=O)O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 3-[2-N-(Biotinyl)aminoethyldithio]propanoic acid Usage And Synthesis |
| Chemical Properties | White Powder | | Uses | 3-[2-N-(Biotinyl)aminoethyldithio]propanoic acid (Biotin-SS-COOH) is a cleavable, biotinylated crosslinkers. The linker can also be used for synthesis of chemical biology tools for labeling target proteins in biological experiments and assays. It possesses dual functionality: enrichment via the biotin and an embedded disulfide bridge for cleavage under reducing conditions. |
| | 3-[2-N-(Biotinyl)aminoethyldithio]propanoic acid Preparation Products And Raw materials |
|