| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Ark Pharm, Inc. |
| Tel: |
847-367-3680 |
| Email: |
sales@arkpharminc.com |
|
| | 3,4-Dichlorobenzenesulfonyl chloride Basic information |
| Product Name: | 3,4-Dichlorobenzenesulfonyl chloride | | Synonyms: | 3,4-dichloro-benzenesulfonylchlorid;3,4-Dichlorophenylsulfonyl chloride;Benzenesulfonyl chloride, 3,4-dichloro-;3,4-DICHLOROBENZENESULPHONYL CHLORIDE;3,4-DICHLOROBENZENESULFONYL CHLORIDE, 95 %;3,4-Dichlorobenzenesulphonyl chloride 98%;3,4-dichlorobenzene-1-sulfonyl chloride;3,4-Dichlorobenzenesulfonic acid chloride | | CAS: | 98-31-7 | | MF: | C6H3Cl3O2S | | MW: | 245.51 | | EINECS: | 202-656-5 | | Product Categories: | Benzenesulfonyl chloride;Benzene derivates;Organic Building Blocks;Sulfonyl Halides;Sulfur Compounds | | Mol File: | 98-31-7.mol |  |
| | 3,4-Dichlorobenzenesulfonyl chloride Chemical Properties |
| Melting point | 20-22°C | | Boiling point | 253 °C(lit.) | | density | 1.572 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.589(lit.) | | Fp | 135 °F | | storage temp. | Inert atmosphere,Room Temperature | | form | powder to lump to clear liquid | | color | White or Colorless to Almost white or Almost colorless | | Sensitive | Moisture Sensitive | | BRN | 1956417 | | InChI | 1S/C6H3Cl3O2S/c7-5-2-1-4(3-6(5)8)12(9,10)11/h1-3H | | InChIKey | NYIBPWGZGSXURD-UHFFFAOYSA-N | | SMILES | Clc1ccc(cc1Cl)S(Cl)(=O)=O | | CAS DataBase Reference | 98-31-7(CAS DataBase Reference) | | EPA Substance Registry System | Benzenesulfonyl chloride, 3,4-dichloro- (98-31-7) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-27-28-36/37/39-45 | | RIDADR | UN 2920 8/PG 2 | | WGK Germany | 3 | | Hazard Note | Corrosive/Moisture Sensitive | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29049090 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Flam. Liq. 3
Skin Corr. 1B |
| | 3,4-Dichlorobenzenesulfonyl chloride Usage And Synthesis |
| Description | 3,4-Dichlorobenzenesulfonyl Chloride, fp 22.4℃, is manufactured from o-dichlorobenzene and chlorosulfuric acid; used as an inexpensive acylating agent.
| | Chemical Properties | Clear colorless to light yellow liquid | | Uses | 3,4-Dichloro-benzenesulfonyl Chloride is a useful reagent for organic synthesis. |
| | 3,4-Dichlorobenzenesulfonyl chloride Preparation Products And Raw materials |
|