| Company Name: |
ChemStrong Scientific Co.,Ltd
|
| Tel: |
0755-0755-66853366 13670046396 |
| Email: |
sales@chem-strong.com |
| Products Intro: |
Product Name:Lidocaine Impurity 40
CAS:780037-66-3
Purity:95% HPLC Package:10ML;25Ml;50ML;100ML
|
| Company Name: |
Shanghai Kewel Chemical Co., Ltd.
|
| Tel: |
021-64609169 18901607656 |
| Email: |
greensnown@163.com |
| Products Intro: |
Product Name:Lidocaine Impurity 30
CAS:780037-66-3
Purity:95+ HPLC; Package:10mg;25mg;50mg;100mg
|
|
| | 4-Imidazolidinone, 2,5-dimethyl-3-(2-methylphenyl)-1-propyl- Basic information |
| | 4-Imidazolidinone, 2,5-dimethyl-3-(2-methylphenyl)-1-propyl- Chemical Properties |
| Boiling point | 417.2±38.0 °C(Predicted) | | density | 1.018±0.06 g/cm3(Predicted) | | pka | 5.02±0.60(Predicted) | | InChI | InChI=1S/C15H22N2O/c1-5-10-16-12(3)15(18)17(13(16)4)14-9-7-6-8-11(14)2/h6-9,12-13H,5,10H2,1-4H3 | | InChIKey | UFQQWOBXRJXBNO-UHFFFAOYSA-N | | SMILES | C1(C)N(CCC)C(C)C(=O)N1C1=CC=CC=C1C |
| | 4-Imidazolidinone, 2,5-dimethyl-3-(2-methylphenyl)-1-propyl- Usage And Synthesis |
| Uses | 2,5-Dimethyl-3-(2-methylphenyl)-1-propylimidazolini-4-one is an impurity of Prilocaine (Prilocaine Hydrochloride P725000). Prilocaine is a local anesthetic of the amino amide type and is often used in dentistry. Prilocaine is also often combined with lidocaine as a preparation for dermal anesthesia (lidocaine/prilocaine or EMLA) towards the treatment of conditions like paresthesia. |
| | 4-Imidazolidinone, 2,5-dimethyl-3-(2-methylphenyl)-1-propyl- Preparation Products And Raw materials |
|