| Company Name: |
ChemStrong Scientific Co.,Ltd
|
| Tel: |
0755-66853366 13670046396 |
| Email: |
sales@chem-strong.com |
| Products Intro: |
Product Name:Rosuvastatin Impurity 132
CAS:1469771-46-7
Purity:95% HPLC Package:10mg;25mg;50mg;100mg
|
| Company Name: |
Hubei Moco Chemical Co., Ltd.
|
| Tel: |
18627756402 |
| Email: |
3001051413@qq.com |
| Products Intro: |
Product Name:Rosuvastatin Impurity 153
CAS:1469771-46-7
Purity:95% Remarks:100g
|
| Company Name: |
Molcoo Chemicals Inc.
|
| Tel: |
18274848843 |
| Email: |
3001006472@qq.com |
| Products Intro: |
Product Name:Rosuvastatin Impurity 153
CAS:1469771-46-7
Purity:95% Package:25mg/RMB 1000;50mg/RMB 2000;100mg/RMB 3000
|
D-erythro-Hexonic acid, 6-S-2-benzothiazolyl-2,4-dideoxy-6-thio-, 1,1-dimethylethyl ester manufacturers
|
| | D-erythro-Hexonic acid, 6-S-2-benzothiazolyl-2,4-dideoxy-6-thio-, 1,1-dimethylethyl ester Basic information |
| | D-erythro-Hexonic acid, 6-S-2-benzothiazolyl-2,4-dideoxy-6-thio-, 1,1-dimethylethyl ester Chemical Properties |
| Boiling point | 546.7±60.0 °C(Predicted) | | density | 1.30±0.1 g/cm3(Predicted) | | pka | 13.86±0.20(Predicted) | | InChI | InChI=1S/C17H23NO4S2/c1-17(2,3)22-15(21)9-11(19)8-12(20)10-23-16-18-13-6-4-5-7-14(13)24-16/h4-7,11-12,19-20H,8-10H2,1-3H3/t11-,12-/m0/s1 | | InChIKey | KWBZUYSMHIAPBU-RYUDHWBXSA-N | | SMILES | C(OC(C)(C)C)(=O)C[C@H](C[C@@H](CSC1=NC2=CC=CC=C2S1)O)O |
| | D-erythro-Hexonic acid, 6-S-2-benzothiazolyl-2,4-dideoxy-6-thio-, 1,1-dimethylethyl ester Usage And Synthesis |
| | D-erythro-Hexonic acid, 6-S-2-benzothiazolyl-2,4-dideoxy-6-thio-, 1,1-dimethylethyl ester Preparation Products And Raw materials |
|