| Company Name: |
AAB-PHARMA LIMITED Gold |
| Tel: |
025-66800956 18800000000 |
| Email: |
sales@njdmchem.com |
| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 2,6-Difluoro-3-hydroxybenzaldehyde Basic information |
| | 2,6-Difluoro-3-hydroxybenzaldehyde Chemical Properties |
| Melting point | 110-114℃ | | Boiling point | 229.9±35.0 °C(Predicted) | | density | 1.464±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | powder | | pka | 8.01±0.23(Predicted) | | color | Orange- buff | | Sensitive | Air Sensitive | | InChI | InChI=1S/C7H4F2O2/c8-5-1-2-6(11)7(9)4(5)3-10/h1-3,11H | | InChIKey | NHGSYGIEJAONJB-UHFFFAOYSA-N | | SMILES | C(=O)C1=C(F)C=CC(O)=C1F |
| Hazard Codes | Xi | | HS Code | 2913000090 |
| | 2,6-Difluoro-3-hydroxybenzaldehyde Usage And Synthesis |
| Uses | 2,6-Difluoro-3-hydroxybenzaldehyde is used in preparation method of imidazoline pyridine compound intermediates. |
| | 2,6-Difluoro-3-hydroxybenzaldehyde Preparation Products And Raw materials |
|