| Company Name: |
PharmaBlock Sciences (Nanjing),Inc.
|
| Tel: |
025-86918202 4000255188 |
| Email: |
sales@pharmablock.com |
| Products Intro: |
Product Name:tert-butyl N-(3-cyanophenyl)carbamate
CAS:145878-50-8
Purity:97 Package:1G;5G;10G;25G
|
| Company Name: |
Alfa Aesar
|
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Products Intro: |
Product Name:3-(Boc-aMino)benzonitrile, 97%
CAS:145878-50-8
Package:250Mg Remarks:H54442
|
| Company Name: |
Adamas Reagent, Ltd.
|
| Tel: |
400-6009262 15618770481 |
| Email: |
yhx@titansci.com |
| Products Intro: |
Product Name:Tert-Butyl (3-Cyanophenyl)Carbamate
CAS:145878-50-8
Purity:99% Package:250mg;1g;5g;25g;100g
|
|
| | Carbamic acid, (3-cyanophenyl)-, 1,1-dimethylethyl ester (9CI) Basic information |
| | Carbamic acid, (3-cyanophenyl)-, 1,1-dimethylethyl ester (9CI) Chemical Properties |
| Melting point | 125-130°C | | Boiling point | 286.6±23.0 °C(Predicted) | | density | 1.12±0.1 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 13.08±0.70(Predicted) | | form | solid | | Appearance | Off-white to light yellow Solid | | InChI | 1S/C12H14N2O2/c1-12(2,3)16-11(15)14-10-6-4-5-9(7-10)8-13/h4-7H,1-3H3,(H,14,15) | | InChIKey | UEEFNFUJFIMRPZ-UHFFFAOYSA-N | | SMILES | CC(C)(C)OC(=O)Nc1cccc(c1)C#N |
| Hazard Codes | Xn | | Risk Statements | 22-43 | | Safety Statements | 36/37 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Skin Sens. 1 |
| | Carbamic acid, (3-cyanophenyl)-, 1,1-dimethylethyl ester (9CI) Usage And Synthesis |
| | Carbamic acid, (3-cyanophenyl)-, 1,1-dimethylethyl ester (9CI) Preparation Products And Raw materials |
|