|
|
| | 1H-Imidazol-5-amine,1-methyl-4-nitro-(9CI) Basic information |
| Product Name: | 1H-Imidazol-5-amine,1-methyl-4-nitro-(9CI) | | Synonyms: | 1H-Imidazol-5-amine,1-methyl-4-nitro-(9CI);(3-methyl-5-nitro-imidazol-4-yl)amine;3-methyl-5-nitro-imidazol-4-amine;3-methyl-5-nitroimidazol-4-amine;Azathioprine impurity A;1-Methyl-4-nitro-1H-imidazol-5-amine;5-Amino-1-methyl-4-nitroimidazole;Azathioprine Related CoMpound A | | CAS: | 4531-54-8 | | MF: | C4H6N4O2 | | MW: | 142.12 | | EINECS: | | | Product Categories: | NITRO | | Mol File: | 4531-54-8.mol |  |
| | 1H-Imidazol-5-amine,1-methyl-4-nitro-(9CI) Chemical Properties |
| Melting point | >288°C (dec.) | | Boiling point | 435.0±25.0 °C(Predicted) | | density | 1.67±0.1 g/cm3(Predicted) | | storage temp. | Hygroscopic, Refrigerator, under inert atmosphere | | solubility | DMSO (Slightly, Heated), Methanol (Very Slightly, Heated) | | pka | 1.07±0.61(Predicted) | | form | solid | | color | Light Yellow to Light Green | | Major Application | pharmaceutical small molecule | | InChI | InChI=1S/C4H6N4O2/c1-7-2-6-4(3(7)5)8(9)10/h2H,5H2,1H3 | | InChIKey | GJVMTMXQJDQJSS-UHFFFAOYSA-N | | SMILES | C1N(C)C(N)=C([N+]([O-])=O)N=1 |
| WGK Germany | WGK 3 | | HS Code | 2933997500 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 1H-Imidazol-5-amine,1-methyl-4-nitro-(9CI) Usage And Synthesis |
| Uses | 5-Amino-1-methyl-4-nitroimidazole is a moiety of Azathioprine (A803350); an immunosuppressive antimetabolite that is also active as a disease modifying antirheumatic drug (DMARD). |
| | 1H-Imidazol-5-amine,1-methyl-4-nitro-(9CI) Preparation Products And Raw materials |
|