|
|
| | eicosapentaenoic acid ethyl ester Basic information |
| Product Name: | eicosapentaenoic acid ethyl ester | | Synonyms: | N-3ETHYLESTERCONCENTRATE;(5Z,8Z,11Z,14Z,17Z)-Icosa-5,8,11,14,17-pentaenoic acid ethyl ester;Epadel;MND-21;EICOSAPENTAENOIC ACID ETHYL ESTER(EPA EE)(SG);Eicosapentaenoic Acid Ethyl Ester
SEE: E477805;WSEKRMRHZOPEHB-UHFFFAOYSA-N;Eicosapentaenoic acid ethyl ester CRS | | CAS: | 73310-10-8 | | MF: | C22H34O2 | | MW: | 0 | | EINECS: | | | Product Categories: | Pharmaceuticals, Intermediates & Fine Chemicals, Miscellaneous Reagents | | Mol File: | 73310-10-8.mol |  |
| | eicosapentaenoic acid ethyl ester Chemical Properties |
| storage temp. | -20°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C22H34O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24-4-2/h12-21H,3-11H2,1-2H3/b13-12+,15-14+,17-16+,19-18+,21-20+ | | InChIKey | DTEMJWLYSQBXEL-MBFZXKRTSA-N | | SMILES | O(CC)C(=O)\C=C\C=C\C=C\C=C\C=C\CCCCCCCCC |
| WGK Germany | WGK 3 | | RTECS | JX3835000 | | Storage Class | 11 - Combustible Solids |
| | eicosapentaenoic acid ethyl ester Usage And Synthesis |
| Uses | Eicosapentaenoic Acid Ethyl Ester is used in the treatment of ischemic brain damage and reduce injury. Also used in the therapeutic treatment of statin-treated patients with persistent high triglycerides. | | Definition | ChEBI: Ethyl (5Z,8Z,11Z,14Z,17Z)-icosapentaenoate is a long-chain fatty acid ethyl ester resulting from the formal condensation of the carboxy group of (5Z,8Z,11Z,14Z,17Z)-icosapentaenoic acid with the hydroxy group of ethanol. It has a role as an anticholesteremic drug, a marine metabolite, an antipsychotic agent, an antidepressant and a prodrug. It is a long-chain fatty acid ethyl ester and a polyunsaturated fatty ester. It is functionally related to an all-cis-5,8,11,14,17-icosapentaenoic acid. |
| | eicosapentaenoic acid ethyl ester Preparation Products And Raw materials |
|