4-Fluoro-3-(trifluoromethyl)phenylacetic acid manufacturers
|
| | 4-Fluoro-3-(trifluoromethyl)phenylacetic acid Basic information |
| | 4-Fluoro-3-(trifluoromethyl)phenylacetic acid Chemical Properties |
| Melting point | 51-55 °C(lit.) | | Boiling point | 263.1±35.0 °C(Predicted) | | density | 1.436±0.06 g/cm3(Predicted) | | Fp | >230 °F | | storage temp. | Sealed in dry,Room Temperature | | pka | 4.11±0.10(Predicted) | | form | crystals | | color | Off-white | | InChI | 1S/C9H6F4O2/c10-7-2-1-5(4-8(14)15)3-6(7)9(11,12)13/h1-3H,4H2,(H,14,15) | | InChIKey | MGQPQAYFSXCYPW-UHFFFAOYSA-N | | SMILES | OC(=O)Cc1ccc(F)c(c1)C(F)(F)F | | CAS DataBase Reference | 220227-47-4(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-36/37 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2916399090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 4-Fluoro-3-(trifluoromethyl)phenylacetic acid Usage And Synthesis |
| | 4-Fluoro-3-(trifluoromethyl)phenylacetic acid Preparation Products And Raw materials |
|