4-acetylaminobiphenyl manufacturers
- 4-acetylaminobiphenyl
-
- $30.00 / 1KG
-
2025-12-12
- CAS:4075-79-0
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 200000KG
|
| | 4-acetylaminobiphenyl Basic information |
| | 4-acetylaminobiphenyl Chemical Properties |
| Melting point | 171°C | | Boiling point | 350.95°C (rough estimate) | | density | 1.0694 (rough estimate) | | refractive index | 1.5780 (estimate) | | storage temp. | Refrigerator | | solubility | Chloroform, Methanol | | form | Solid | | color | Crystals from MeOH (aq) | | InChI | InChI=1S/C14H13NO/c1-11(16)15-14-9-7-13(8-10-14)12-5-3-2-4-6-12/h2-10H,1H3,(H,15,16) | | InChIKey | SVLDILRDQOVJED-UHFFFAOYSA-N | | SMILES | C(NC1=CC=C(C2=CC=CC=C2)C=C1)(=O)C | | EPA Substance Registry System | Acetamide, N-[1,1'-biphenyl]-4-yl- (4075-79-0) |
| TSCA | TSCA listed | | Hazardous Substances Data | 4075-79-0(Hazardous Substances Data) | | Toxicity | TDLo orl-rat: 2770 mg/kg/21W-C:CAR CNREA8 15,188,55 orl-rat TD:4070 mg/kg/34W-C:CAR CNREA8 16,525,56 |
| | 4-acetylaminobiphenyl Usage And Synthesis |
| Chemical Properties | Light Tan Solid | | Uses | N-Acetyl-4-aminobiphenyl is a metabolite of 4-Aminobiphenyl, a procarcinogenic agent. | | Definition | ChEBI: 4-Acetylaminobiphenyl is a member of biphenyls. | | Safety Profile | Questionable carcinogen with experimental carcinogenic and tumorigenic data. Mutation data reported. When heated to decomposition it emits toxic fumes of NO,. Used in the manufacture of plastics, resins, rubber, synthetics, dyes, and pigments. |
| | 4-acetylaminobiphenyl Preparation Products And Raw materials |
|