| Company Name: |
Clearsynth Labs Limited
|
| Tel: |
+91-22-26355700 |
| Email: |
info@clearsynth.com |
| Products Intro: |
Product Name:TetraMethyl-d12-aMMoniuM BroMide CAS:284474-82-4 Remarks:CS-C-02860
|
| Company Name: |
ChengDu SinoStandards Bio-Tech Co.,Ltd. ,
|
| Tel: |
028-83243028 19136088901 |
| Email: |
sinostandards@163.com |
| Products Intro: |
Product Name:Tetramethyl-d12-ammonium Bromide CAS:284474-82-4 Purity:标准品 Package:10mg;100mg;1g
|
| Company Name: |
Yancheng Tongming Biotechnology Co., Ltd.
|
| Tel: |
15195160625 |
| Email: |
2863565288@qq.com |
| Products Intro: |
Product Name:Tetramethyl-d12-ammonium Bromide CAS:284474-82-4 Purity:98% HPLC Package:0.25 g In Stock
0.5 g In Stock
|
| Company Name: |
LGC Science (Shanghai) Ltd.
|
| Tel: |
17717235263 |
| Email: |
cindy.yang@lgcgroup.com |
| Products Intro: |
Product Name:Tetramethyl-d12-ammonium Bromide CAS:284474-82-4 Purity:具体纯度,见COA Package:0.25g Remarks:CDN-D-0968
|
|
| | TETRAMETHYL-D12-AMMONIUM BROMIDE Basic information |
| | TETRAMETHYL-D12-AMMONIUM BROMIDE Chemical Properties |
| Melting point | >300 °C | | form | solid | | InChI | 1S/C4H12N.BrH/c1-5(2,3)4;/h1-4H3;1H/q+1;/p-1/i1D3,2D3,3D3,4D3; | | InChIKey | DDFYFBUWEBINLX-KXWZVCIVSA-M | | SMILES | [2H]C([2H])([2H])[N+](C([2H])([2H])[2H])(C([2H])([2H])[2H])C([2H])([2H])[2H].[Br-] |
| Hazard Codes | T | | Risk Statements | 25-36/37/38 | | Safety Statements | 26-45 | | RIDADR | UN 2811 6.1/PG 2 | | WGK Germany | WGK 3 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials | | Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | TETRAMETHYL-D12-AMMONIUM BROMIDE Usage And Synthesis |
| Uses | Tetramethyl-d12-ammonium Bromide (CAS# 284474-82-4) is a useful isotopically labeled research compound. |
| | TETRAMETHYL-D12-AMMONIUM BROMIDE Preparation Products And Raw materials |
|