|
|
| | 3-OXO-5-CARBOXYPERHYDRO-1,4-THIAZINE Basic information |
| Product Name: | 3-OXO-5-CARBOXYPERHYDRO-1,4-THIAZINE | | Synonyms: | 3-OXO-5-CARBOXYPERHYDRO-1,4-THIAZINE;5-OXO-THIOMORPHOLINE-3-CARBOXYLIC ACID;Carbocysteine impurity A;Carbocysteine Impurity 2;(RS)-carbocystein e lactam;Carbocisteine Impurity 9;Cysteine Impurity 2;3-Thiomorpholinecarboxylic acid, 5-oxo- | | CAS: | 14226-97-2 | | MF: | C5H7NO3S | | MW: | 161.18 | | EINECS: | | | Product Categories: | pharmacetical | | Mol File: | Mol File |  |
| | 3-OXO-5-CARBOXYPERHYDRO-1,4-THIAZINE Chemical Properties |
| Melting point | 154 - 156°C | | Boiling point | 530.3±50.0 °C(Predicted) | | density | 1.455±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 3.26±0.20(Predicted) | | color | Pale Beige to Pale Brown | | InChI | InChI=1S/C5H7NO3S/c7-4-2-10-1-3(6-4)5(8)9/h3H,1-2H2,(H,6,7)(H,8,9) | | InChIKey | ZCITVSIKDJSWSS-UHFFFAOYSA-N | | SMILES | N1C(=O)CSCC1C(O)=O |
| Hazard Codes | Xi | | HazardClass | IRRITANT |
| | 3-OXO-5-CARBOXYPERHYDRO-1,4-THIAZINE Usage And Synthesis |
| Uses | 5-Oxothiomorpholine-3-carboxylic Acid is an impurity of Carbocistene (C178760), a mucolytic agent used in the treatment of respiratory disorders ranging from the influenza virus infection to chronic obstructive pulmonary disease (COPD). |
| | 3-OXO-5-CARBOXYPERHYDRO-1,4-THIAZINE Preparation Products And Raw materials |
|